C25H23N3O6S — CID 5034950
[2-(5-methoxy-2-methyl-4-nitroanilino)-2-oxoethyl] 3-phenothiazin-10-ylpropanoate (PubChem CID 5034950) has the molecular formula C25H23N3O6S and a molecular weight of 493.54 g/mol. Its IUPAC name is [2-(5-methoxy-2-methyl-4-nitroanilino)-2-oxoethyl] 3-phenothiazin-10-ylpropanoate.
| Compound Name | [2-(5-methoxy-2-methyl-4-nitroanilino)-2-oxoethyl] 3-phenothiazin-10-ylpropanoate |
|---|---|
| PubChem CID | 5034950 |
| Molecular Formula | C25H23N3O6S |
| Molecular Weight | 493.54 g/mol |
| Exact Mass | 493.13 |
| IUPAC Name | [2-(5-methoxy-2-methyl-4-nitroanilino)-2-oxoethyl] 3-phenothiazin-10-ylpropanoate |
| SMILES | COc1cc(NC(=O)COC(=O)CCN2c3ccccc3Sc3ccccc32)c(C)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C25H23N3O6S/c1-16-13-20(28(31)32)21(33-2)14-17(16)26-24(29)15-34-25(30)11-12-27-18-7-3-5-9-22(18)35-23-10-6-4-8-19(23)27/h3-10,13-14H,11-12,15H2,1-2H3,(H,26,29) |
| InChIKey | OSRDZTIGLLGCCG-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 111.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.54 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het_thio_666_A(13)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|