About 5-hydroxy-3,6-bis(hydroxymethyl)-7-oxabicyclo[4.1.0]hept-3-en-2-one
5-hydroxy-3,6-bis(hydroxymethyl)-7-oxabicyclo[4.1.0]hept-3-en-2-one (PubChem CID 5035293) has the molecular formula C8H10O5
and a molecular weight of 186.16 g/mol. Its IUPAC name is 5-hydroxy-3,6-bis(hydroxymethyl)-7-oxabicyclo[4.1.0]hept-3-en-2-one.
Molecular Properties
| Compound Name | 5-hydroxy-3,6-bis(hydroxymethyl)-7-oxabicyclo[4.1.0]hept-3-en-2-one |
| PubChem CID | 5035293 |
| Molecular Formula | C8H10O5 |
| Molecular Weight | 186.16 g/mol |
| Exact Mass | 186.05 |
| IUPAC Name | 5-hydroxy-3,6-bis(hydroxymethyl)-7-oxabicyclo[4.1.0]hept-3-en-2-one |
| SMILES | O=C1C(CO)=CC(O)C2(CO)OC12 |
| InChI | InChI=1S/C8H10O5/c9-2-4-1-5(11)8(3-10)7(13-8)6(4)12/h1,5,7,9-11H,2-3H2 |
| InChIKey | WYPKXNNNLKQNEX-UHFFFAOYSA-N |
| XLogP | -2.02 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.16 |
| LogP ≤ 5 | -2.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 5-hydroxy-3,6-bis(hydroxymethyl)-7-oxabicyclo[4.1.0]hept-3-en-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-hydroxy-3,6-bis(hydroxymethyl)-7-oxabicyclo[4.1.0]hept-3-en-2-one?
The IUPAC name of 5-hydroxy-3,6-bis(hydroxymethyl)-7-oxabicyclo[4.1.0]hept-3-en-2-one (CID 5035293) is 5-hydroxy-3,6-bis(hydroxymethyl)-7-oxabicyclo[4.1.0]hept-3-en-2-one.
What is the SMILES notation for 5-hydroxy-3,6-bis(hydroxymethyl)-7-oxabicyclo[4.1.0]hept-3-en-2-one?
The canonical SMILES for 5-hydroxy-3,6-bis(hydroxymethyl)-7-oxabicyclo[4.1.0]hept-3-en-2-one is O=C1C(CO)=CC(O)C2(CO)OC12.
What is the InChIKey of 5-hydroxy-3,6-bis(hydroxymethyl)-7-oxabicyclo[4.1.0]hept-3-en-2-one?
The InChIKey is WYPKXNNNLKQNEX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10O5/c9-2-4-1-5(11)8(3-10)7(13-8)6(4)12/h1,5,7,9-11H,2-3H2.
What are the key properties of 5-hydroxy-3,6-bis(hydroxymethyl)-7-oxabicyclo[4.1.0]hept-3-en-2-one?
5-hydroxy-3,6-bis(hydroxymethyl)-7-oxabicyclo[4.1.0]hept-3-en-2-one has a molecular weight of 186.16 g/mol, XLogP of -2.02, 2 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-hydroxy-3,6-bis(hydroxymethyl)-7-oxabicyclo[4.1.0]hept-3-en-2-one is sourced from PubChem (CID 5035293), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).