C19H25FO3 — CID 5035987
17-hydroxy-13-methyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-10-carbonyl fluoride (PubChem CID 5035987) has the molecular formula C19H25FO3 and a molecular weight of 320.40 g/mol. Its IUPAC name is 17-hydroxy-13-methyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-10-carbonyl fluoride.
| Compound Name | 17-hydroxy-13-methyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-10-carbonyl fluoride |
|---|---|
| PubChem CID | 5035987 |
| Molecular Formula | C19H25FO3 |
| Molecular Weight | 320.40 g/mol |
| Exact Mass | 320.18 |
| IUPAC Name | 17-hydroxy-13-methyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-10-carbonyl fluoride |
| SMILES | CC12CCC3C(CCC4=CC(=O)CCC43C(=O)F)C1CCC2O |
| InChI | InChI=1S/C19H25FO3/c1-18-8-7-15-13(14(18)4-5-16(18)22)3-2-11-10-12(21)6-9-19(11,15)17(20)23/h10,13-16,22H,2-9H2,1H3 |
| InChIKey | BAQFZOVIPZMHIB-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.40 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|