C19H18N4O3S2 — CID 5036879
N-(6-methyl-1,3-benzothiazol-2-yl)-1-(2-nitrophenyl)sulfanylpyrrolidine-2-carboxamide (PubChem CID 5036879) has the molecular formula C19H18N4O3S2 and a molecular weight of 414.51 g/mol. Its IUPAC name is N-(6-methyl-1,3-benzothiazol-2-yl)-1-(2-nitrophenyl)sulfanylpyrrolidine-2-carboxamide.
| Compound Name | N-(6-methyl-1,3-benzothiazol-2-yl)-1-(2-nitrophenyl)sulfanylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 5036879 |
| Molecular Formula | C19H18N4O3S2 |
| Molecular Weight | 414.51 g/mol |
| Exact Mass | 414.08 |
| IUPAC Name | N-(6-methyl-1,3-benzothiazol-2-yl)-1-(2-nitrophenyl)sulfanylpyrrolidine-2-carboxamide |
| SMILES | Cc1ccc2nc(NC(=O)C3CCCN3Sc3ccccc3[N+](=O)[O-])sc2c1 |
| InChI | InChI=1S/C19H18N4O3S2/c1-12-8-9-13-17(11-12)27-19(20-13)21-18(24)15-6-4-10-22(15)28-16-7-3-2-5-14(16)23(25)26/h2-3,5,7-9,11,15H,4,6,10H2,1H3,(H,20,21,24) |
| InChIKey | AEGBJONAPLVDKL-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 88.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.51 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|