About O-[2-(1,3-dioxoisoindol-2-yl)ethyl] N-benzoyl-N-(4-bromophenyl)carbamothioate
O-[2-(1,3-dioxoisoindol-2-yl)ethyl] N-benzoyl-N-(4-bromophenyl)carbamothioate (PubChem CID 503690) has the molecular formula C24H17BrN2O4S
and a molecular weight of 509.38 g/mol. Its IUPAC name is O-[2-(1,3-dioxoisoindol-2-yl)ethyl] N-benzoyl-N-(4-bromophenyl)carbamothioate.
Molecular Properties
| Compound Name | O-[2-(1,3-dioxoisoindol-2-yl)ethyl] N-benzoyl-N-(4-bromophenyl)carbamothioate |
| PubChem CID | 503690 |
| Molecular Formula | C24H17BrN2O4S |
| Molecular Weight | 509.38 g/mol |
| Exact Mass | 508.01 |
| IUPAC Name | O-[2-(1,3-dioxoisoindol-2-yl)ethyl] N-benzoyl-N-(4-bromophenyl)carbamothioate |
| SMILES | O=C1c2ccccc2C(=O)N1CCOC(=S)N(C(=O)c1ccccc1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C24H17BrN2O4S/c25-17-10-12-18(13-11-17)27(21(28)16-6-2-1-3-7-16)24(32)31-15-14-26-22(29)19-8-4-5-9-20(19)23(26)30/h1-13H,14-15H2 |
| InChIKey | SDCYYYJRPPHIEQ-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 509.38 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze O-[2-(1,3-dioxoisoindol-2-yl)ethyl] N-benzoyl-N-(4-bromophenyl)carbamothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of O-[2-(1,3-dioxoisoindol-2-yl)ethyl] N-benzoyl-N-(4-bromophenyl)carbamothioate?
The IUPAC name of O-[2-(1,3-dioxoisoindol-2-yl)ethyl] N-benzoyl-N-(4-bromophenyl)carbamothioate (CID 503690) is O-[2-(1,3-dioxoisoindol-2-yl)ethyl] N-benzoyl-N-(4-bromophenyl)carbamothioate.
What is the SMILES notation for O-[2-(1,3-dioxoisoindol-2-yl)ethyl] N-benzoyl-N-(4-bromophenyl)carbamothioate?
The canonical SMILES for O-[2-(1,3-dioxoisoindol-2-yl)ethyl] N-benzoyl-N-(4-bromophenyl)carbamothioate is O=C1c2ccccc2C(=O)N1CCOC(=S)N(C(=O)c1ccccc1)c1ccc(Br)cc1.
What is the InChIKey of O-[2-(1,3-dioxoisoindol-2-yl)ethyl] N-benzoyl-N-(4-bromophenyl)carbamothioate?
The InChIKey is SDCYYYJRPPHIEQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H17BrN2O4S/c25-17-10-12-18(13-11-17)27(21(28)16-6-2-1-3-7-16)24(32)31-15-14-26-22(29)19-8-4-5-9-20(19)23(26)30/h1-13H,14-15H2.
What are the key properties of O-[2-(1,3-dioxoisoindol-2-yl)ethyl] N-benzoyl-N-(4-bromophenyl)carbamothioate?
O-[2-(1,3-dioxoisoindol-2-yl)ethyl] N-benzoyl-N-(4-bromophenyl)carbamothioate has a molecular weight of 509.38 g/mol, XLogP of 4.69, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for O-[2-(1,3-dioxoisoindol-2-yl)ethyl] N-benzoyl-N-(4-bromophenyl)carbamothioate is sourced from PubChem (CID 503690), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).