C28H27NO4S2 — CID 5036953
5-[[3-methoxy-4-[2-[4-(2-phenylpropan-2-yl)phenoxy]ethoxy]phenyl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 5036953) has the molecular formula C28H27NO4S2 and a molecular weight of 505.66 g/mol. Its IUPAC name is 5-[[3-methoxy-4-[2-[4-(2-phenylpropan-2-yl)phenoxy]ethoxy]phenyl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | 5-[[3-methoxy-4-[2-[4-(2-phenylpropan-2-yl)phenoxy]ethoxy]phenyl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 5036953 |
| Molecular Formula | C28H27NO4S2 |
| Molecular Weight | 505.66 g/mol |
| Exact Mass | 505.14 |
| IUPAC Name | 5-[[3-methoxy-4-[2-[4-(2-phenylpropan-2-yl)phenoxy]ethoxy]phenyl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | COc1cc(C=C2SC(=S)NC2=O)ccc1OCCOc1ccc(C(C)(C)c2ccccc2)cc1 |
| InChI | InChI=1S/C28H27NO4S2/c1-28(2,20-7-5-4-6-8-20)21-10-12-22(13-11-21)32-15-16-33-23-14-9-19(17-24(23)31-3)18-25-26(30)29-27(34)35-25/h4-14,17-18H,15-16H2,1-3H3,(H,29,30,34) |
| InChIKey | HSRPAKUFSAQFOE-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.66 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|