C26H52N8S — CID 503772
1-[[5-(1,4,8,11-tetrazacyclotetradec-1-ylmethyl)thiophen-2-yl]methyl]-1,4,8,11-tetrazacyclotetradecane (PubChem CID 503772) has the molecular formula C26H52N8S and a molecular weight of 508.83 g/mol. Its IUPAC name is 1-[[5-(1,4,8,11-tetrazacyclotetradec-1-ylmethyl)thiophen-2-yl]methyl]-1,4,8,11-tetrazacyclotetradecane.
| Compound Name | 1-[[5-(1,4,8,11-tetrazacyclotetradec-1-ylmethyl)thiophen-2-yl]methyl]-1,4,8,11-tetrazacyclotetradecane |
|---|---|
| PubChem CID | 503772 |
| Molecular Formula | C26H52N8S |
| Molecular Weight | 508.83 g/mol |
| Exact Mass | 508.40 |
| IUPAC Name | 1-[[5-(1,4,8,11-tetrazacyclotetradec-1-ylmethyl)thiophen-2-yl]methyl]-1,4,8,11-tetrazacyclotetradecane |
| SMILES | c1cc(CN2CCCNCCNCCCNCC2)sc1CN1CCCNCCNCCCNCC1 |
| InChI | InChI=1S/C26H52N8S/c1-7-27-13-15-29-11-3-19-33(21-17-31-9-1)23-25-5-6-26(35-25)24-34-20-4-12-30-16-14-28-8-2-10-32-18-22-34/h5-6,27-32H,1-4,7-24H2 |
| InChIKey | VABFVYHLECCOIA-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 78.66 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.83 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |