C16H27Cl2N5 — CID 503774
1-[(2,6-dichloro-4-pyridinyl)methyl]-1,4,8,11-tetrazacyclotetradecane (PubChem CID 503774) has the molecular formula C16H27Cl2N5 and a molecular weight of 360.33 g/mol. Its IUPAC name is 1-[(2,6-dichloro-4-pyridinyl)methyl]-1,4,8,11-tetrazacyclotetradecane.
| Compound Name | 1-[(2,6-dichloro-4-pyridinyl)methyl]-1,4,8,11-tetrazacyclotetradecane |
|---|---|
| PubChem CID | 503774 |
| Molecular Formula | C16H27Cl2N5 |
| Molecular Weight | 360.33 g/mol |
| Exact Mass | 359.16 |
| IUPAC Name | 1-[(2,6-dichloro-4-pyridinyl)methyl]-1,4,8,11-tetrazacyclotetradecane |
| SMILES | Clc1cc(CN2CCCNCCNCCCNCC2)cc(Cl)n1 |
| InChI | InChI=1S/C16H27Cl2N5/c17-15-11-14(12-16(18)22-15)13-23-9-2-5-20-7-6-19-3-1-4-21-8-10-23/h11-12,19-21H,1-10,13H2 |
| InChIKey | BOLSWSQFGOVHCQ-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 52.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.33 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|