C22H30N4O9 — CID 5037989
1-[2-[[3-hydroxy-2-[(3-hydroxy-4-methyl-2-nitrobenzoyl)amino]butanoyl]amino]-3-methylbutanoyl]pyrrolidine-2-carboxylic acid (PubChem CID 5037989) has the molecular formula C22H30N4O9 and a molecular weight of 494.50 g/mol. Its IUPAC name is 1-[2-[[3-hydroxy-2-[(3-hydroxy-4-methyl-2-nitrobenzoyl)amino]butanoyl]amino]-3-methylbutanoyl]pyrrolidine-2-carboxylic acid.
| Compound Name | 1-[2-[[3-hydroxy-2-[(3-hydroxy-4-methyl-2-nitrobenzoyl)amino]butanoyl]amino]-3-methylbutanoyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 5037989 |
| Molecular Formula | C22H30N4O9 |
| Molecular Weight | 494.50 g/mol |
| Exact Mass | 494.20 |
| IUPAC Name | 1-[2-[[3-hydroxy-2-[(3-hydroxy-4-methyl-2-nitrobenzoyl)amino]butanoyl]amino]-3-methylbutanoyl]pyrrolidine-2-carboxylic acid |
| SMILES | Cc1ccc(C(=O)NC(C(=O)NC(C(=O)N2CCCC2C(=O)O)C(C)C)C(C)O)c([N+](=O)[O-])c1O |
| InChI | InChI=1S/C22H30N4O9/c1-10(2)15(21(31)25-9-5-6-14(25)22(32)33)23-20(30)16(12(4)27)24-19(29)13-8-7-11(3)18(28)17(13)26(34)35/h7-8,10,12,14-16,27-28H,5-6,9H2,1-4H3,(H,23,30)(H,24,29)(H,32,33) |
| InChIKey | XZIFCEZYICLXSV-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 199.41 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.50 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|