C36H48N2O10 — CID 503799
(2R,3R,4R,5R)-3,4-dihydroxy-2,5-bis(phenylmethoxy)-N-[(3S,5S)-5-(prop-2-enoxymethyl)oxolan-3-yl]-N'-[(5S)-5-(prop-2-enoxymethyl)oxolan-3-yl]hexanediamide (PubChem CID 503799) has the molecular formula C36H48N2O10 and a molecular weight of 668.78 g/mol. Its IUPAC name is (2R,3R,4R,5R)-3,4-dihydroxy-2,5-bis(phenylmethoxy)-N-[(3S,5S)-5-(prop-2-enoxymethyl)oxolan-3-yl]-N'-[(5S)-5-(prop-2-enoxymethyl)oxolan-3-yl]hexanediamide.
| Compound Name | (2R,3R,4R,5R)-3,4-dihydroxy-2,5-bis(phenylmethoxy)-N-[(3S,5S)-5-(prop-2-enoxymethyl)oxolan-3-yl]-N'-[(5S)-5-(prop-2-enoxymethyl)oxolan-3-yl]hexanediamide |
|---|---|
| PubChem CID | 503799 |
| Molecular Formula | C36H48N2O10 |
| Molecular Weight | 668.78 g/mol |
| Exact Mass | 668.33 |
| IUPAC Name | (2R,3R,4R,5R)-3,4-dihydroxy-2,5-bis(phenylmethoxy)-N-[(3S,5S)-5-(prop-2-enoxymethyl)oxolan-3-yl]-N'-[(5S)-5-(prop-2-enoxymethyl)oxolan-3-yl]hexanediamide |
| SMILES | C=CCOC[C@@H]1CC(NC(=O)[C@H](OCc2ccccc2)[C@H](O)[C@@H](O)[C@@H](OCc2ccccc2)C(=O)N[C@@H]2CO[C@H](COCC=C)C2)CO1 |
| InChI | InChI=1S/C36H48N2O10/c1-3-15-43-23-29-17-27(21-45-29)37-35(41)33(47-19-25-11-7-5-8-12-25)31(39)32(40)34(48-20-26-13-9-6-10-14-26)36(42)38-28-18-30(46-22-28)24-44-16-4-2/h3-14,27-34,39-40H,1-2,15-24H2,(H,37,41)(H,38,42)/t27-,28?,29-,30-,31+,32+,33+,34+/m0/s1 |
| InChIKey | XKFFOYGHNKSLLI-YEWWNNNASA-N |
| XLogP | 1.83 |
| TPSA | 154.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.78 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|