C34H48N2O10 — CID 503801
(2R,3R,4R,5R)-N-[(3S,5S)-5-(ethoxymethyl)oxolan-3-yl]-N'-[(5S)-5-(ethoxymethyl)oxolan-3-yl]-3,4-dihydroxy-2,5-bis(phenylmethoxy)hexanediamide (PubChem CID 503801) has the molecular formula C34H48N2O10 and a molecular weight of 644.76 g/mol. Its IUPAC name is (2R,3R,4R,5R)-N-[(3S,5S)-5-(ethoxymethyl)oxolan-3-yl]-N'-[(5S)-5-(ethoxymethyl)oxolan-3-yl]-3,4-dihydroxy-2,5-bis(phenylmethoxy)hexanediamide.
| Compound Name | (2R,3R,4R,5R)-N-[(3S,5S)-5-(ethoxymethyl)oxolan-3-yl]-N'-[(5S)-5-(ethoxymethyl)oxolan-3-yl]-3,4-dihydroxy-2,5-bis(phenylmethoxy)hexanediamide |
|---|---|
| PubChem CID | 503801 |
| Molecular Formula | C34H48N2O10 |
| Molecular Weight | 644.76 g/mol |
| Exact Mass | 644.33 |
| IUPAC Name | (2R,3R,4R,5R)-N-[(3S,5S)-5-(ethoxymethyl)oxolan-3-yl]-N'-[(5S)-5-(ethoxymethyl)oxolan-3-yl]-3,4-dihydroxy-2,5-bis(phenylmethoxy)hexanediamide |
| SMILES | CCOC[C@@H]1CC(NC(=O)[C@H](OCc2ccccc2)[C@H](O)[C@@H](O)[C@@H](OCc2ccccc2)C(=O)N[C@@H]2CO[C@H](COCC)C2)CO1 |
| InChI | InChI=1S/C34H48N2O10/c1-3-41-21-27-15-25(19-43-27)35-33(39)31(45-17-23-11-7-5-8-12-23)29(37)30(38)32(46-18-24-13-9-6-10-14-24)34(40)36-26-16-28(44-20-26)22-42-4-2/h5-14,25-32,37-38H,3-4,15-22H2,1-2H3,(H,35,39)(H,36,40)/t25-,26?,27-,28-,29+,30+,31+,32+/m0/s1 |
| InChIKey | KMCWZHPLLICHPE-OLMABHHBSA-N |
| XLogP | 1.50 |
| TPSA | 154.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.76 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |