C28H39N3O6S2 — CID 503878
propyl 7-methylidene-5,9-bis-(4-methylphenyl)sulfonyl-1,5,9-triazacyclododecane-1-carboxylate (PubChem CID 503878) has the molecular formula C28H39N3O6S2 and a molecular weight of 577.77 g/mol. Its IUPAC name is propyl 7-methylidene-5,9-bis-(4-methylphenyl)sulfonyl-1,5,9-triazacyclododecane-1-carboxylate.
| Compound Name | propyl 7-methylidene-5,9-bis-(4-methylphenyl)sulfonyl-1,5,9-triazacyclododecane-1-carboxylate |
|---|---|
| PubChem CID | 503878 |
| Molecular Formula | C28H39N3O6S2 |
| Molecular Weight | 577.77 g/mol |
| Exact Mass | 577.23 |
| IUPAC Name | propyl 7-methylidene-5,9-bis-(4-methylphenyl)sulfonyl-1,5,9-triazacyclododecane-1-carboxylate |
| SMILES | C=C1CN(S(=O)(=O)c2ccc(C)cc2)CCCN(C(=O)OCCC)CCCN(S(=O)(=O)c2ccc(C)cc2)C1 |
| InChI | InChI=1S/C28H39N3O6S2/c1-5-20-37-28(32)29-16-6-18-30(38(33,34)26-12-8-23(2)9-13-26)21-25(4)22-31(19-7-17-29)39(35,36)27-14-10-24(3)11-15-27/h8-15H,4-7,16-22H2,1-3H3 |
| InChIKey | OYPIZFGUZSCSEI-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 104.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.77 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|