C19H18N4O4S — CID 5039717
N-(2-methoxyphenyl)-2-[(4-methylphenyl)sulfonylamino]pyrimidine-5-carboxamide (PubChem CID 5039717) has the molecular formula C19H18N4O4S and a molecular weight of 398.44 g/mol. Its IUPAC name is N-(2-methoxyphenyl)-2-[(4-methylphenyl)sulfonylamino]pyrimidine-5-carboxamide.
| Compound Name | N-(2-methoxyphenyl)-2-[(4-methylphenyl)sulfonylamino]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 5039717 |
| Molecular Formula | C19H18N4O4S |
| Molecular Weight | 398.44 g/mol |
| Exact Mass | 398.10 |
| IUPAC Name | N-(2-methoxyphenyl)-2-[(4-methylphenyl)sulfonylamino]pyrimidine-5-carboxamide |
| SMILES | COc1ccccc1NC(=O)c1cnc(NS(=O)(=O)c2ccc(C)cc2)nc1 |
| InChI | InChI=1S/C19H18N4O4S/c1-13-7-9-15(10-8-13)28(25,26)23-19-20-11-14(12-21-19)18(24)22-16-5-3-4-6-17(16)27-2/h3-12H,1-2H3,(H,22,24)(H,20,21,23) |
| InChIKey | RCJNIVRXSMXMFQ-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 110.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.44 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |