C22H22O3S — CID 503995
(4aS,7aS)-6,7a-diphenylspiro[4a,7-dihydrocyclopenta[e][1,2,4]trioxine-3,4'-thiane] (PubChem CID 503995) has the molecular formula C22H22O3S and a molecular weight of 366.48 g/mol. Its IUPAC name is (4aS,7aS)-6,7a-diphenylspiro[4a,7-dihydrocyclopenta[e][1,2,4]trioxine-3,4'-thiane].
| Compound Name | (4aS,7aS)-6,7a-diphenylspiro[4a,7-dihydrocyclopenta[e][1,2,4]trioxine-3,4'-thiane] |
|---|---|
| PubChem CID | 503995 |
| Molecular Formula | C22H22O3S |
| Molecular Weight | 366.48 g/mol |
| Exact Mass | 366.13 |
| IUPAC Name | (4aS,7aS)-6,7a-diphenylspiro[4a,7-dihydrocyclopenta[e][1,2,4]trioxine-3,4'-thiane] |
| SMILES | C1=C(c2ccccc2)C[C@@]2(c3ccccc3)OOC3(CCSCC3)O[C@@H]12 |
| InChI | InChI=1S/C22H22O3S/c1-3-7-17(8-4-1)18-15-20-22(16-18,19-9-5-2-6-10-19)25-24-21(23-20)11-13-26-14-12-21/h1-10,15,20H,11-14,16H2/t20-,22-/m0/s1 |
| InChIKey | OPCMJIHVMJVUIF-UNMCSNQZSA-N |
| XLogP | 4.94 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.48 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|