2-(4-amino-3-oxo-1,2-oxazolidin-2-yl)acetic acid

C5H8N2O4 — CID 504014

IUPAC2-(4-amino-3-oxo-1,2-oxazolidin-2-yl)acetic acid
SMILESNC1CON(CC(=O)O)C1=O
InChIInChI=1S/C5H8N2O4/c6-3-2-11-7(5(3)10)1-4(8)9/h3H,1-2,6H2,(H,8,9)
InChIKeyBLNMVEHKBXUWAG-UHFFFAOYSA-N
MW160.13 g/mol
LogP-1.83
Rot. Bonds2

About 2-(4-amino-3-oxo-1,2-oxazolidin-2-yl)acetic acid

2-(4-amino-3-oxo-1,2-oxazolidin-2-yl)acetic acid (PubChem CID 504014) has the molecular formula C5H8N2O4 and a molecular weight of 160.13 g/mol. Its IUPAC name is 2-(4-amino-3-oxo-1,2-oxazolidin-2-yl)acetic acid.

Molecular Properties

Compound Name2-(4-amino-3-oxo-1,2-oxazolidin-2-yl)acetic acid
PubChem CID504014
Molecular FormulaC5H8N2O4
Molecular Weight160.13 g/mol
Exact Mass160.05
IUPAC Name2-(4-amino-3-oxo-1,2-oxazolidin-2-yl)acetic acid
SMILESNC1CON(CC(=O)O)C1=O
InChIInChI=1S/C5H8N2O4/c6-3-2-11-7(5(3)10)1-4(8)9/h3H,1-2,6H2,(H,8,9)
InChIKeyBLNMVEHKBXUWAG-UHFFFAOYSA-N
XLogP-1.83
TPSA92.86 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500160.13
LogP ≤ 5-1.83
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 2-(4-amino-3-oxo-1,2-oxazolidin-2-yl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(4-amino-3-oxo-1,2-oxazolidin-2-yl)acetic acid?
The IUPAC name of 2-(4-amino-3-oxo-1,2-oxazolidin-2-yl)acetic acid (CID 504014) is 2-(4-amino-3-oxo-1,2-oxazolidin-2-yl)acetic acid.
What is the SMILES notation for 2-(4-amino-3-oxo-1,2-oxazolidin-2-yl)acetic acid?
The canonical SMILES for 2-(4-amino-3-oxo-1,2-oxazolidin-2-yl)acetic acid is NC1CON(CC(=O)O)C1=O.
What is the InChIKey of 2-(4-amino-3-oxo-1,2-oxazolidin-2-yl)acetic acid?
The InChIKey is BLNMVEHKBXUWAG-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8N2O4/c6-3-2-11-7(5(3)10)1-4(8)9/h3H,1-2,6H2,(H,8,9).
What are the key properties of 2-(4-amino-3-oxo-1,2-oxazolidin-2-yl)acetic acid?
2-(4-amino-3-oxo-1,2-oxazolidin-2-yl)acetic acid has a molecular weight of 160.13 g/mol, XLogP of -1.83, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-amino-3-oxo-1,2-oxazolidin-2-yl)acetic acid is sourced from PubChem (CID 504014), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).