About 5-[3-[(2,4-diaminopyrimidin-5-yl)methyl]-4-methoxyphenyl]pentanoic acid
5-[3-[(2,4-diaminopyrimidin-5-yl)methyl]-4-methoxyphenyl]pentanoic acid (PubChem CID 504025) has the molecular formula C17H22N4O3
and a molecular weight of 330.39 g/mol. Its IUPAC name is 5-[3-[(2,4-diaminopyrimidin-5-yl)methyl]-4-methoxyphenyl]pentanoic acid.
Molecular Properties
| Compound Name | 5-[3-[(2,4-diaminopyrimidin-5-yl)methyl]-4-methoxyphenyl]pentanoic acid |
| PubChem CID | 504025 |
| Molecular Formula | C17H22N4O3 |
| Molecular Weight | 330.39 g/mol |
| Exact Mass | 330.17 |
| IUPAC Name | 5-[3-[(2,4-diaminopyrimidin-5-yl)methyl]-4-methoxyphenyl]pentanoic acid |
| SMILES | COc1ccc(CCCCC(=O)O)cc1Cc1cnc(N)nc1N |
| InChI | InChI=1S/C17H22N4O3/c1-24-14-7-6-11(4-2-3-5-15(22)23)8-12(14)9-13-10-20-17(19)21-16(13)18/h6-8,10H,2-5,9H2,1H3,(H,22,23)(H4,18,19,20,21) |
| InChIKey | SXJCFBANUYLDDS-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 124.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.39 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-[3-[(2,4-diaminopyrimidin-5-yl)methyl]-4-methoxyphenyl]pentanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[3-[(2,4-diaminopyrimidin-5-yl)methyl]-4-methoxyphenyl]pentanoic acid?
The IUPAC name of 5-[3-[(2,4-diaminopyrimidin-5-yl)methyl]-4-methoxyphenyl]pentanoic acid (CID 504025) is 5-[3-[(2,4-diaminopyrimidin-5-yl)methyl]-4-methoxyphenyl]pentanoic acid.
What is the SMILES notation for 5-[3-[(2,4-diaminopyrimidin-5-yl)methyl]-4-methoxyphenyl]pentanoic acid?
The canonical SMILES for 5-[3-[(2,4-diaminopyrimidin-5-yl)methyl]-4-methoxyphenyl]pentanoic acid is COc1ccc(CCCCC(=O)O)cc1Cc1cnc(N)nc1N.
What is the InChIKey of 5-[3-[(2,4-diaminopyrimidin-5-yl)methyl]-4-methoxyphenyl]pentanoic acid?
The InChIKey is SXJCFBANUYLDDS-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H22N4O3/c1-24-14-7-6-11(4-2-3-5-15(22)23)8-12(14)9-13-10-20-17(19)21-16(13)18/h6-8,10H,2-5,9H2,1H3,(H,22,23)(H4,18,19,20,21).
What are the key properties of 5-[3-[(2,4-diaminopyrimidin-5-yl)methyl]-4-methoxyphenyl]pentanoic acid?
5-[3-[(2,4-diaminopyrimidin-5-yl)methyl]-4-methoxyphenyl]pentanoic acid has a molecular weight of 330.39 g/mol, XLogP of 2.04, 8 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[3-[(2,4-diaminopyrimidin-5-yl)methyl]-4-methoxyphenyl]pentanoic acid is sourced from PubChem (CID 504025), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).