About 6-[3-[(2,4-diaminopyrimidin-5-yl)methyl]-4-methoxyphenyl]hexanoic acid
6-[3-[(2,4-diaminopyrimidin-5-yl)methyl]-4-methoxyphenyl]hexanoic acid (PubChem CID 504026) has the molecular formula C18H24N4O3
and a molecular weight of 344.42 g/mol. Its IUPAC name is 6-[3-[(2,4-diaminopyrimidin-5-yl)methyl]-4-methoxyphenyl]hexanoic acid.
Molecular Properties
| Compound Name | 6-[3-[(2,4-diaminopyrimidin-5-yl)methyl]-4-methoxyphenyl]hexanoic acid |
| PubChem CID | 504026 |
| Molecular Formula | C18H24N4O3 |
| Molecular Weight | 344.42 g/mol |
| Exact Mass | 344.18 |
| IUPAC Name | 6-[3-[(2,4-diaminopyrimidin-5-yl)methyl]-4-methoxyphenyl]hexanoic acid |
| SMILES | COc1ccc(CCCCCC(=O)O)cc1Cc1cnc(N)nc1N |
| InChI | InChI=1S/C18H24N4O3/c1-25-15-8-7-12(5-3-2-4-6-16(23)24)9-13(15)10-14-11-21-18(20)22-17(14)19/h7-9,11H,2-6,10H2,1H3,(H,23,24)(H4,19,20,21,22) |
| InChIKey | LJRZTUYWOPFKKK-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 124.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.42 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-[3-[(2,4-diaminopyrimidin-5-yl)methyl]-4-methoxyphenyl]hexanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[3-[(2,4-diaminopyrimidin-5-yl)methyl]-4-methoxyphenyl]hexanoic acid?
The IUPAC name of 6-[3-[(2,4-diaminopyrimidin-5-yl)methyl]-4-methoxyphenyl]hexanoic acid (CID 504026) is 6-[3-[(2,4-diaminopyrimidin-5-yl)methyl]-4-methoxyphenyl]hexanoic acid.
What is the SMILES notation for 6-[3-[(2,4-diaminopyrimidin-5-yl)methyl]-4-methoxyphenyl]hexanoic acid?
The canonical SMILES for 6-[3-[(2,4-diaminopyrimidin-5-yl)methyl]-4-methoxyphenyl]hexanoic acid is COc1ccc(CCCCCC(=O)O)cc1Cc1cnc(N)nc1N.
What is the InChIKey of 6-[3-[(2,4-diaminopyrimidin-5-yl)methyl]-4-methoxyphenyl]hexanoic acid?
The InChIKey is LJRZTUYWOPFKKK-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H24N4O3/c1-25-15-8-7-12(5-3-2-4-6-16(23)24)9-13(15)10-14-11-21-18(20)22-17(14)19/h7-9,11H,2-6,10H2,1H3,(H,23,24)(H4,19,20,21,22).
What are the key properties of 6-[3-[(2,4-diaminopyrimidin-5-yl)methyl]-4-methoxyphenyl]hexanoic acid?
6-[3-[(2,4-diaminopyrimidin-5-yl)methyl]-4-methoxyphenyl]hexanoic acid has a molecular weight of 344.42 g/mol, XLogP of 2.43, 9 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[3-[(2,4-diaminopyrimidin-5-yl)methyl]-4-methoxyphenyl]hexanoic acid is sourced from PubChem (CID 504026), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).