About 7-[3-[(2,4-diaminopyrimidin-5-yl)methyl]-4-methoxyphenyl]heptanoic acid
7-[3-[(2,4-diaminopyrimidin-5-yl)methyl]-4-methoxyphenyl]heptanoic acid (PubChem CID 504027) has the molecular formula C19H26N4O3
and a molecular weight of 358.44 g/mol. Its IUPAC name is 7-[3-[(2,4-diaminopyrimidin-5-yl)methyl]-4-methoxyphenyl]heptanoic acid.
Molecular Properties
| Compound Name | 7-[3-[(2,4-diaminopyrimidin-5-yl)methyl]-4-methoxyphenyl]heptanoic acid |
| PubChem CID | 504027 |
| Molecular Formula | C19H26N4O3 |
| Molecular Weight | 358.44 g/mol |
| Exact Mass | 358.20 |
| IUPAC Name | 7-[3-[(2,4-diaminopyrimidin-5-yl)methyl]-4-methoxyphenyl]heptanoic acid |
| SMILES | COc1ccc(CCCCCCC(=O)O)cc1Cc1cnc(N)nc1N |
| InChI | InChI=1S/C19H26N4O3/c1-26-16-9-8-13(6-4-2-3-5-7-17(24)25)10-14(16)11-15-12-22-19(21)23-18(15)20/h8-10,12H,2-7,11H2,1H3,(H,24,25)(H4,20,21,22,23) |
| InChIKey | PFSOPZHDFBSZSZ-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 124.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.44 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 7-[3-[(2,4-diaminopyrimidin-5-yl)methyl]-4-methoxyphenyl]heptanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-[3-[(2,4-diaminopyrimidin-5-yl)methyl]-4-methoxyphenyl]heptanoic acid?
The IUPAC name of 7-[3-[(2,4-diaminopyrimidin-5-yl)methyl]-4-methoxyphenyl]heptanoic acid (CID 504027) is 7-[3-[(2,4-diaminopyrimidin-5-yl)methyl]-4-methoxyphenyl]heptanoic acid.
What is the SMILES notation for 7-[3-[(2,4-diaminopyrimidin-5-yl)methyl]-4-methoxyphenyl]heptanoic acid?
The canonical SMILES for 7-[3-[(2,4-diaminopyrimidin-5-yl)methyl]-4-methoxyphenyl]heptanoic acid is COc1ccc(CCCCCCC(=O)O)cc1Cc1cnc(N)nc1N.
What is the InChIKey of 7-[3-[(2,4-diaminopyrimidin-5-yl)methyl]-4-methoxyphenyl]heptanoic acid?
The InChIKey is PFSOPZHDFBSZSZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H26N4O3/c1-26-16-9-8-13(6-4-2-3-5-7-17(24)25)10-14(16)11-15-12-22-19(21)23-18(15)20/h8-10,12H,2-7,11H2,1H3,(H,24,25)(H4,20,21,22,23).
What are the key properties of 7-[3-[(2,4-diaminopyrimidin-5-yl)methyl]-4-methoxyphenyl]heptanoic acid?
7-[3-[(2,4-diaminopyrimidin-5-yl)methyl]-4-methoxyphenyl]heptanoic acid has a molecular weight of 358.44 g/mol, XLogP of 2.82, 10 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 7-[3-[(2,4-diaminopyrimidin-5-yl)methyl]-4-methoxyphenyl]heptanoic acid is sourced from PubChem (CID 504027), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).