About 3-[[3-[(2,4-diaminopyrimidin-5-yl)methyl]-4-methoxyphenoxy]methyl]benzoic acid
3-[[3-[(2,4-diaminopyrimidin-5-yl)methyl]-4-methoxyphenoxy]methyl]benzoic acid (PubChem CID 504028) has the molecular formula C20H20N4O4
and a molecular weight of 380.40 g/mol. Its IUPAC name is 3-[[3-[(2,4-diaminopyrimidin-5-yl)methyl]-4-methoxyphenoxy]methyl]benzoic acid.
Molecular Properties
| Compound Name | 3-[[3-[(2,4-diaminopyrimidin-5-yl)methyl]-4-methoxyphenoxy]methyl]benzoic acid |
| PubChem CID | 504028 |
| Molecular Formula | C20H20N4O4 |
| Molecular Weight | 380.40 g/mol |
| Exact Mass | 380.15 |
| IUPAC Name | 3-[[3-[(2,4-diaminopyrimidin-5-yl)methyl]-4-methoxyphenoxy]methyl]benzoic acid |
| SMILES | COc1ccc(OCc2cccc(C(=O)O)c2)cc1Cc1cnc(N)nc1N |
| InChI | InChI=1S/C20H20N4O4/c1-27-17-6-5-16(28-11-12-3-2-4-13(7-12)19(25)26)9-14(17)8-15-10-23-20(22)24-18(15)21/h2-7,9-10H,8,11H2,1H3,(H,25,26)(H4,21,22,23,24) |
| InChIKey | JQUDVRQNCIBTMP-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 133.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 380.40 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 3-[[3-[(2,4-diaminopyrimidin-5-yl)methyl]-4-methoxyphenoxy]methyl]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[3-[(2,4-diaminopyrimidin-5-yl)methyl]-4-methoxyphenoxy]methyl]benzoic acid?
The IUPAC name of 3-[[3-[(2,4-diaminopyrimidin-5-yl)methyl]-4-methoxyphenoxy]methyl]benzoic acid (CID 504028) is 3-[[3-[(2,4-diaminopyrimidin-5-yl)methyl]-4-methoxyphenoxy]methyl]benzoic acid.
What is the SMILES notation for 3-[[3-[(2,4-diaminopyrimidin-5-yl)methyl]-4-methoxyphenoxy]methyl]benzoic acid?
The canonical SMILES for 3-[[3-[(2,4-diaminopyrimidin-5-yl)methyl]-4-methoxyphenoxy]methyl]benzoic acid is COc1ccc(OCc2cccc(C(=O)O)c2)cc1Cc1cnc(N)nc1N.
What is the InChIKey of 3-[[3-[(2,4-diaminopyrimidin-5-yl)methyl]-4-methoxyphenoxy]methyl]benzoic acid?
The InChIKey is JQUDVRQNCIBTMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H20N4O4/c1-27-17-6-5-16(28-11-12-3-2-4-13(7-12)19(25)26)9-14(17)8-15-10-23-20(22)24-18(15)21/h2-7,9-10H,8,11H2,1H3,(H,25,26)(H4,21,22,23,24).
What are the key properties of 3-[[3-[(2,4-diaminopyrimidin-5-yl)methyl]-4-methoxyphenoxy]methyl]benzoic acid?
3-[[3-[(2,4-diaminopyrimidin-5-yl)methyl]-4-methoxyphenoxy]methyl]benzoic acid has a molecular weight of 380.40 g/mol, XLogP of 2.52, 7 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[3-[(2,4-diaminopyrimidin-5-yl)methyl]-4-methoxyphenoxy]methyl]benzoic acid is sourced from PubChem (CID 504028), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).