About N,N-dimethyl-3-(3-oxo-1,2-benzothiazol-2-yl)benzenesulfonamide
N,N-dimethyl-3-(3-oxo-1,2-benzothiazol-2-yl)benzenesulfonamide (PubChem CID 5040456) has the molecular formula C15H14N2O3S2
and a molecular weight of 334.42 g/mol. Its IUPAC name is N,N-dimethyl-3-(3-oxo-1,2-benzothiazol-2-yl)benzenesulfonamide.
Molecular Properties
| Compound Name | N,N-dimethyl-3-(3-oxo-1,2-benzothiazol-2-yl)benzenesulfonamide |
| PubChem CID | 5040456 |
| Molecular Formula | C15H14N2O3S2 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.04 |
| IUPAC Name | N,N-dimethyl-3-(3-oxo-1,2-benzothiazol-2-yl)benzenesulfonamide |
| SMILES | CN(C)S(=O)(=O)c1cccc(-n2sc3ccccc3c2=O)c1 |
| InChI | InChI=1S/C15H14N2O3S2/c1-16(2)22(19,20)12-7-5-6-11(10-12)17-15(18)13-8-3-4-9-14(13)21-17/h3-10H,1-2H3 |
| InChIKey | SHVMSYDTOYCGDZ-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 59.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N,N-dimethyl-3-(3-oxo-1,2-benzothiazol-2-yl)benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethyl-3-(3-oxo-1,2-benzothiazol-2-yl)benzenesulfonamide?
The IUPAC name of N,N-dimethyl-3-(3-oxo-1,2-benzothiazol-2-yl)benzenesulfonamide (CID 5040456) is N,N-dimethyl-3-(3-oxo-1,2-benzothiazol-2-yl)benzenesulfonamide.
What is the SMILES notation for N,N-dimethyl-3-(3-oxo-1,2-benzothiazol-2-yl)benzenesulfonamide?
The canonical SMILES for N,N-dimethyl-3-(3-oxo-1,2-benzothiazol-2-yl)benzenesulfonamide is CN(C)S(=O)(=O)c1cccc(-n2sc3ccccc3c2=O)c1.
What is the InChIKey of N,N-dimethyl-3-(3-oxo-1,2-benzothiazol-2-yl)benzenesulfonamide?
The InChIKey is SHVMSYDTOYCGDZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14N2O3S2/c1-16(2)22(19,20)12-7-5-6-11(10-12)17-15(18)13-8-3-4-9-14(13)21-17/h3-10H,1-2H3.
What are the key properties of N,N-dimethyl-3-(3-oxo-1,2-benzothiazol-2-yl)benzenesulfonamide?
N,N-dimethyl-3-(3-oxo-1,2-benzothiazol-2-yl)benzenesulfonamide has a molecular weight of 334.42 g/mol, XLogP of 2.30, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethyl-3-(3-oxo-1,2-benzothiazol-2-yl)benzenesulfonamide is sourced from PubChem (CID 5040456), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).