About 3-butyl-1,1-diethylurea
3-butyl-1,1-diethylurea (PubChem CID 5041064) has the molecular formula C9H20N2O
and a molecular weight of 172.27 g/mol. Its IUPAC name is 3-butyl-1,1-diethylurea.
Molecular Properties
| Compound Name | 3-butyl-1,1-diethylurea |
| PubChem CID | 5041064 |
| Molecular Formula | C9H20N2O |
| Molecular Weight | 172.27 g/mol |
| Exact Mass | 172.16 |
| IUPAC Name | 3-butyl-1,1-diethylurea |
| SMILES | CCCCNC(=O)N(CC)CC |
| InChI | InChI=1S/C9H20N2O/c1-4-7-8-10-9(12)11(5-2)6-3/h4-8H2,1-3H3,(H,10,12) |
| InChIKey | JLVNXPRVQXNQBM-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.27 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-butyl-1,1-diethylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-butyl-1,1-diethylurea?
The IUPAC name of 3-butyl-1,1-diethylurea (CID 5041064) is 3-butyl-1,1-diethylurea.
What is the SMILES notation for 3-butyl-1,1-diethylurea?
The canonical SMILES for 3-butyl-1,1-diethylurea is CCCCNC(=O)N(CC)CC.
What is the InChIKey of 3-butyl-1,1-diethylurea?
The InChIKey is JLVNXPRVQXNQBM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H20N2O/c1-4-7-8-10-9(12)11(5-2)6-3/h4-8H2,1-3H3,(H,10,12).
What are the key properties of 3-butyl-1,1-diethylurea?
3-butyl-1,1-diethylurea has a molecular weight of 172.27 g/mol, XLogP of 1.84, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-butyl-1,1-diethylurea is sourced from PubChem (CID 5041064), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).