C17H13ClF3NO3 — CID 5041298
2-[2-chloro-5-(trifluoromethyl)phenyl]-4,7-dimethyl-3a,7a-dihydro-4,7-epoxyisoindole-1,3-dione (PubChem CID 5041298) has the molecular formula C17H13ClF3NO3 and a molecular weight of 371.74 g/mol. Its IUPAC name is 2-[2-chloro-5-(trifluoromethyl)phenyl]-4,7-dimethyl-3a,7a-dihydro-4,7-epoxyisoindole-1,3-dione.
| Compound Name | 2-[2-chloro-5-(trifluoromethyl)phenyl]-4,7-dimethyl-3a,7a-dihydro-4,7-epoxyisoindole-1,3-dione |
|---|---|
| PubChem CID | 5041298 |
| Molecular Formula | C17H13ClF3NO3 |
| Molecular Weight | 371.74 g/mol |
| Exact Mass | 371.05 |
| IUPAC Name | 2-[2-chloro-5-(trifluoromethyl)phenyl]-4,7-dimethyl-3a,7a-dihydro-4,7-epoxyisoindole-1,3-dione |
| SMILES | CC12C=CC(C)(O1)C1C(=O)N(c3cc(C(F)(F)F)ccc3Cl)C(=O)C12 |
| InChI | InChI=1S/C17H13ClF3NO3/c1-15-5-6-16(2,25-15)12-11(15)13(23)22(14(12)24)10-7-8(17(19,20)21)3-4-9(10)18/h3-7,11-12H,1-2H3 |
| InChIKey | BYVFOFBKVZWNOW-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.74 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|