About hexadecanoate
hexadecanoate (PubChem CID 504166) has the molecular formula C16H31O2-
and a molecular weight of 255.42 g/mol. Its IUPAC name is hexadecanoate.
Molecular Properties
| Compound Name | hexadecanoate |
| PubChem CID | 504166 |
| Molecular Formula | C16H31O2- |
| Molecular Weight | 255.42 g/mol |
| Exact Mass | 255.23 |
| IUPAC Name | hexadecanoate |
| SMILES | CCCCCCCCCCCCCCCC(=O)[O-] |
| InChI | InChI=1S/C16H32O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16(17)18/h2-15H2,1H3,(H,17,18)/p-1 |
| InChIKey | IPCSVZSSVZVIGE-UHFFFAOYSA-M |
| XLogP | 4.22 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.42 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze hexadecanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hexadecanoate?
The IUPAC name of hexadecanoate (CID 504166) is hexadecanoate.
What is the SMILES notation for hexadecanoate?
The canonical SMILES for hexadecanoate is CCCCCCCCCCCCCCCC(=O)[O-].
What is the InChIKey of hexadecanoate?
The InChIKey is IPCSVZSSVZVIGE-UHFFFAOYSA-M. The full InChI is InChI=1S/C16H32O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16(17)18/h2-15H2,1H3,(H,17,18)/p-1.
What are the key properties of hexadecanoate?
hexadecanoate has a molecular weight of 255.42 g/mol, XLogP of 4.22, 14 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for hexadecanoate is sourced from PubChem (CID 504166), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).