C19H19BrFN3O — CID 5042199
N-[(3-bromophenyl)methyl]-5-(4-fluorophenyl)-1-(2-methoxyethyl)imidazol-2-amine (PubChem CID 5042199) has the molecular formula C19H19BrFN3O and a molecular weight of 404.28 g/mol. Its IUPAC name is N-[(3-bromophenyl)methyl]-5-(4-fluorophenyl)-1-(2-methoxyethyl)imidazol-2-amine.
| Compound Name | N-[(3-bromophenyl)methyl]-5-(4-fluorophenyl)-1-(2-methoxyethyl)imidazol-2-amine |
|---|---|
| PubChem CID | 5042199 |
| Molecular Formula | C19H19BrFN3O |
| Molecular Weight | 404.28 g/mol |
| Exact Mass | 403.07 |
| IUPAC Name | N-[(3-bromophenyl)methyl]-5-(4-fluorophenyl)-1-(2-methoxyethyl)imidazol-2-amine |
| SMILES | COCCn1c(-c2ccc(F)cc2)cnc1NCc1cccc(Br)c1 |
| InChI | InChI=1S/C19H19BrFN3O/c1-25-10-9-24-18(15-5-7-17(21)8-6-15)13-23-19(24)22-12-14-3-2-4-16(20)11-14/h2-8,11,13H,9-10,12H2,1H3,(H,22,23) |
| InChIKey | ZBZCAKFATHRHDF-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.28 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |