About 7-chloro-1-oxido-1,2,4-benzotriazin-1-ium-3-amine
7-chloro-1-oxido-1,2,4-benzotriazin-1-ium-3-amine (PubChem CID 504232) has the molecular formula C7H5ClN4O
and a molecular weight of 196.60 g/mol. Its IUPAC name is 7-chloro-1-oxido-1,2,4-benzotriazin-1-ium-3-amine.
Molecular Properties
| Compound Name | 7-chloro-1-oxido-1,2,4-benzotriazin-1-ium-3-amine |
| PubChem CID | 504232 |
| Molecular Formula | C7H5ClN4O |
| Molecular Weight | 196.60 g/mol |
| Exact Mass | 196.02 |
| IUPAC Name | 7-chloro-1-oxido-1,2,4-benzotriazin-1-ium-3-amine |
| SMILES | Nc1nc2ccc(Cl)cc2[n+]([O-])n1 |
| InChI | InChI=1S/C7H5ClN4O/c8-4-1-2-5-6(3-4)12(13)11-7(9)10-5/h1-3H,(H2,9,10,11) |
| InChIKey | OXILOAZZXVNKSG-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 78.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.60 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 7-chloro-1-oxido-1,2,4-benzotriazin-1-ium-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-chloro-1-oxido-1,2,4-benzotriazin-1-ium-3-amine?
The IUPAC name of 7-chloro-1-oxido-1,2,4-benzotriazin-1-ium-3-amine (CID 504232) is 7-chloro-1-oxido-1,2,4-benzotriazin-1-ium-3-amine.
What is the SMILES notation for 7-chloro-1-oxido-1,2,4-benzotriazin-1-ium-3-amine?
The canonical SMILES for 7-chloro-1-oxido-1,2,4-benzotriazin-1-ium-3-amine is Nc1nc2ccc(Cl)cc2[n+]([O-])n1.
What is the InChIKey of 7-chloro-1-oxido-1,2,4-benzotriazin-1-ium-3-amine?
The InChIKey is OXILOAZZXVNKSG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5ClN4O/c8-4-1-2-5-6(3-4)12(13)11-7(9)10-5/h1-3H,(H2,9,10,11).
What are the key properties of 7-chloro-1-oxido-1,2,4-benzotriazin-1-ium-3-amine?
7-chloro-1-oxido-1,2,4-benzotriazin-1-ium-3-amine has a molecular weight of 196.60 g/mol, XLogP of 0.50, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-chloro-1-oxido-1,2,4-benzotriazin-1-ium-3-amine is sourced from PubChem (CID 504232), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).