C28H33N3O4 — CID 5042527
2-[[2-(4-ethoxyanilino)-2-oxoethyl]-(2-phenylethyl)amino]-N-(4-ethoxyphenyl)acetamide (PubChem CID 5042527) has the molecular formula C28H33N3O4 and a molecular weight of 475.59 g/mol. Its IUPAC name is 2-[[2-(4-ethoxyanilino)-2-oxoethyl]-(2-phenylethyl)amino]-N-(4-ethoxyphenyl)acetamide.
| Compound Name | 2-[[2-(4-ethoxyanilino)-2-oxoethyl]-(2-phenylethyl)amino]-N-(4-ethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 5042527 |
| Molecular Formula | C28H33N3O4 |
| Molecular Weight | 475.59 g/mol |
| Exact Mass | 475.25 |
| IUPAC Name | 2-[[2-(4-ethoxyanilino)-2-oxoethyl]-(2-phenylethyl)amino]-N-(4-ethoxyphenyl)acetamide |
| SMILES | CCOc1ccc(NC(=O)CN(CCc2ccccc2)CC(=O)Nc2ccc(OCC)cc2)cc1 |
| InChI | InChI=1S/C28H33N3O4/c1-3-34-25-14-10-23(11-15-25)29-27(32)20-31(19-18-22-8-6-5-7-9-22)21-28(33)30-24-12-16-26(17-13-24)35-4-2/h5-17H,3-4,18-21H2,1-2H3,(H,29,32)(H,30,33) |
| InChIKey | QJBHDUGVYUSMEO-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.59 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |