About (2-oxocyclohexyl) 3-(5-methylfuran-2-yl)prop-2-enoate
(2-oxocyclohexyl) 3-(5-methylfuran-2-yl)prop-2-enoate (PubChem CID 5043248) has the molecular formula C14H16O4
and a molecular weight of 248.28 g/mol. Its IUPAC name is (2-oxocyclohexyl) 3-(5-methylfuran-2-yl)prop-2-enoate.
Molecular Properties
| Compound Name | (2-oxocyclohexyl) 3-(5-methylfuran-2-yl)prop-2-enoate |
| PubChem CID | 5043248 |
| Molecular Formula | C14H16O4 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.10 |
| IUPAC Name | (2-oxocyclohexyl) 3-(5-methylfuran-2-yl)prop-2-enoate |
| SMILES | Cc1ccc(C=CC(=O)OC2CCCCC2=O)o1 |
| InChI | InChI=1S/C14H16O4/c1-10-6-7-11(17-10)8-9-14(16)18-13-5-3-2-4-12(13)15/h6-9,13H,2-5H2,1H3 |
| InChIKey | UFEPNFIFLMIIJK-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 56.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (2-oxocyclohexyl) 3-(5-methylfuran-2-yl)prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-oxocyclohexyl) 3-(5-methylfuran-2-yl)prop-2-enoate?
The IUPAC name of (2-oxocyclohexyl) 3-(5-methylfuran-2-yl)prop-2-enoate (CID 5043248) is (2-oxocyclohexyl) 3-(5-methylfuran-2-yl)prop-2-enoate.
What is the SMILES notation for (2-oxocyclohexyl) 3-(5-methylfuran-2-yl)prop-2-enoate?
The canonical SMILES for (2-oxocyclohexyl) 3-(5-methylfuran-2-yl)prop-2-enoate is Cc1ccc(C=CC(=O)OC2CCCCC2=O)o1.
What is the InChIKey of (2-oxocyclohexyl) 3-(5-methylfuran-2-yl)prop-2-enoate?
The InChIKey is UFEPNFIFLMIIJK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16O4/c1-10-6-7-11(17-10)8-9-14(16)18-13-5-3-2-4-12(13)15/h6-9,13H,2-5H2,1H3.
What are the key properties of (2-oxocyclohexyl) 3-(5-methylfuran-2-yl)prop-2-enoate?
(2-oxocyclohexyl) 3-(5-methylfuran-2-yl)prop-2-enoate has a molecular weight of 248.28 g/mol, XLogP of 2.66, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-oxocyclohexyl) 3-(5-methylfuran-2-yl)prop-2-enoate is sourced from PubChem (CID 5043248), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).