About 4-ethylsulfonyl-1,1-dimethylpiperazin-1-ium
4-ethylsulfonyl-1,1-dimethylpiperazin-1-ium (PubChem CID 504336) has the molecular formula C8H19N2O2S+
and a molecular weight of 207.32 g/mol. Its IUPAC name is 4-ethylsulfonyl-1,1-dimethylpiperazin-1-ium.
Molecular Properties
| Compound Name | 4-ethylsulfonyl-1,1-dimethylpiperazin-1-ium |
| PubChem CID | 504336 |
| Molecular Formula | C8H19N2O2S+ |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.12 |
| IUPAC Name | 4-ethylsulfonyl-1,1-dimethylpiperazin-1-ium |
| SMILES | CCS(=O)(=O)N1CC[N+](C)(C)CC1 |
| InChI | InChI=1S/C8H19N2O2S/c1-4-13(11,12)9-5-7-10(2,3)8-6-9/h4-8H2,1-3H3/q+1 |
| InChIKey | ARVBLGVZMOYDHB-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 4-ethylsulfonyl-1,1-dimethylpiperazin-1-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethylsulfonyl-1,1-dimethylpiperazin-1-ium?
The IUPAC name of 4-ethylsulfonyl-1,1-dimethylpiperazin-1-ium (CID 504336) is 4-ethylsulfonyl-1,1-dimethylpiperazin-1-ium.
What is the SMILES notation for 4-ethylsulfonyl-1,1-dimethylpiperazin-1-ium?
The canonical SMILES for 4-ethylsulfonyl-1,1-dimethylpiperazin-1-ium is CCS(=O)(=O)N1CC[N+](C)(C)CC1.
What is the InChIKey of 4-ethylsulfonyl-1,1-dimethylpiperazin-1-ium?
The InChIKey is ARVBLGVZMOYDHB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H19N2O2S/c1-4-13(11,12)9-5-7-10(2,3)8-6-9/h4-8H2,1-3H3/q+1.
What are the key properties of 4-ethylsulfonyl-1,1-dimethylpiperazin-1-ium?
4-ethylsulfonyl-1,1-dimethylpiperazin-1-ium has a molecular weight of 207.32 g/mol, XLogP of -0.27, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethylsulfonyl-1,1-dimethylpiperazin-1-ium is sourced from PubChem (CID 504336), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).