About 3,5-dinitropyridin-2-amine
3,5-dinitropyridin-2-amine (PubChem CID 504340) has the molecular formula C5H4N4O4
and a molecular weight of 184.11 g/mol. Its IUPAC name is 3,5-dinitropyridin-2-amine.
Molecular Properties
| Compound Name | 3,5-dinitropyridin-2-amine |
| PubChem CID | 504340 |
| Molecular Formula | C5H4N4O4 |
| Molecular Weight | 184.11 g/mol |
| Exact Mass | 184.02 |
| IUPAC Name | 3,5-dinitropyridin-2-amine |
| SMILES | Nc1ncc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C5H4N4O4/c6-5-4(9(12)13)1-3(2-7-5)8(10)11/h1-2H,(H2,6,7) |
| InChIKey | QNZDCKBBTJYQDT-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 125.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.11 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3,5-dinitropyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-dinitropyridin-2-amine?
The IUPAC name of 3,5-dinitropyridin-2-amine (CID 504340) is 3,5-dinitropyridin-2-amine.
What is the SMILES notation for 3,5-dinitropyridin-2-amine?
The canonical SMILES for 3,5-dinitropyridin-2-amine is Nc1ncc([N+](=O)[O-])cc1[N+](=O)[O-].
What is the InChIKey of 3,5-dinitropyridin-2-amine?
The InChIKey is QNZDCKBBTJYQDT-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H4N4O4/c6-5-4(9(12)13)1-3(2-7-5)8(10)11/h1-2H,(H2,6,7).
What are the key properties of 3,5-dinitropyridin-2-amine?
3,5-dinitropyridin-2-amine has a molecular weight of 184.11 g/mol, XLogP of 0.48, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dinitropyridin-2-amine is sourced from PubChem (CID 504340), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).