About [1-[2-(2,5-dimethylphenoxy)ethyl]indol-3-yl]-thiophen-2-ylmethanone
[1-[2-(2,5-dimethylphenoxy)ethyl]indol-3-yl]-thiophen-2-ylmethanone (PubChem CID 5043514) has the molecular formula C23H21NO2S
and a molecular weight of 375.49 g/mol. Its IUPAC name is [1-[2-(2,5-dimethylphenoxy)ethyl]indol-3-yl]-thiophen-2-ylmethanone.
Molecular Properties
| Compound Name | [1-[2-(2,5-dimethylphenoxy)ethyl]indol-3-yl]-thiophen-2-ylmethanone |
| PubChem CID | 5043514 |
| Molecular Formula | C23H21NO2S |
| Molecular Weight | 375.49 g/mol |
| Exact Mass | 375.13 |
| IUPAC Name | [1-[2-(2,5-dimethylphenoxy)ethyl]indol-3-yl]-thiophen-2-ylmethanone |
| SMILES | Cc1ccc(C)c(OCCn2cc(C(=O)c3cccs3)c3ccccc32)c1 |
| InChI | InChI=1S/C23H21NO2S/c1-16-9-10-17(2)21(14-16)26-12-11-24-15-19(18-6-3-4-7-20(18)24)23(25)22-8-5-13-27-22/h3-10,13-15H,11-12H2,1-2H3 |
| InChIKey | CGDYFXUOTLCPNW-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 375.49 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [1-[2-(2,5-dimethylphenoxy)ethyl]indol-3-yl]-thiophen-2-ylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[2-(2,5-dimethylphenoxy)ethyl]indol-3-yl]-thiophen-2-ylmethanone?
The IUPAC name of [1-[2-(2,5-dimethylphenoxy)ethyl]indol-3-yl]-thiophen-2-ylmethanone (CID 5043514) is [1-[2-(2,5-dimethylphenoxy)ethyl]indol-3-yl]-thiophen-2-ylmethanone.
What is the SMILES notation for [1-[2-(2,5-dimethylphenoxy)ethyl]indol-3-yl]-thiophen-2-ylmethanone?
The canonical SMILES for [1-[2-(2,5-dimethylphenoxy)ethyl]indol-3-yl]-thiophen-2-ylmethanone is Cc1ccc(C)c(OCCn2cc(C(=O)c3cccs3)c3ccccc32)c1.
What is the InChIKey of [1-[2-(2,5-dimethylphenoxy)ethyl]indol-3-yl]-thiophen-2-ylmethanone?
The InChIKey is CGDYFXUOTLCPNW-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H21NO2S/c1-16-9-10-17(2)21(14-16)26-12-11-24-15-19(18-6-3-4-7-20(18)24)23(25)22-8-5-13-27-22/h3-10,13-15H,11-12H2,1-2H3.
What are the key properties of [1-[2-(2,5-dimethylphenoxy)ethyl]indol-3-yl]-thiophen-2-ylmethanone?
[1-[2-(2,5-dimethylphenoxy)ethyl]indol-3-yl]-thiophen-2-ylmethanone has a molecular weight of 375.49 g/mol, XLogP of 5.63, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[2-(2,5-dimethylphenoxy)ethyl]indol-3-yl]-thiophen-2-ylmethanone is sourced from PubChem (CID 5043514), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).