C15H9Cl3N3O2P — CID 5043530
4'-phenyl-6'-(trichloromethyl)spiro[1,3,2λ5-benzodioxaphosphole-2,2'-1,3,5-triaza-2λ5-phosphacyclohexa-2,4,6-triene] (PubChem CID 5043530) has the molecular formula C15H9Cl3N3O2P and a molecular weight of 400.59 g/mol. Its IUPAC name is 4'-phenyl-6'-(trichloromethyl)spiro[1,3,2λ5-benzodioxaphosphole-2,2'-1,3,5-triaza-2λ5-phosphacyclohexa-2,4,6-triene].
| Compound Name | 4'-phenyl-6'-(trichloromethyl)spiro[1,3,2λ5-benzodioxaphosphole-2,2'-1,3,5-triaza-2λ5-phosphacyclohexa-2,4,6-triene] |
|---|---|
| PubChem CID | 5043530 |
| Molecular Formula | C15H9Cl3N3O2P |
| Molecular Weight | 400.59 g/mol |
| Exact Mass | 398.95 |
| IUPAC Name | 4'-phenyl-6'-(trichloromethyl)spiro[1,3,2λ5-benzodioxaphosphole-2,2'-1,3,5-triaza-2λ5-phosphacyclohexa-2,4,6-triene] |
| SMILES | ClC(Cl)(Cl)C1=NP2(=NC(c3ccccc3)=N1)Oc1ccccc1O2 |
| InChI | InChI=1S/C15H9Cl3N3O2P/c16-15(17,18)14-19-13(10-6-2-1-3-7-10)20-24(21-14)22-11-8-4-5-9-12(11)23-24/h1-9H |
| InChIKey | VIGKTGBMJSZJFL-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 55.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.59 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|