About N-(6-bicyclo[3.2.0]hept-2-enylideneamino)-2-hydroxy-2,2-diphenylacetamide
N-(6-bicyclo[3.2.0]hept-2-enylideneamino)-2-hydroxy-2,2-diphenylacetamide (PubChem CID 5043950) has the molecular formula C21H20N2O2
and a molecular weight of 332.40 g/mol. Its IUPAC name is N-(6-bicyclo[3.2.0]hept-2-enylideneamino)-2-hydroxy-2,2-diphenylacetamide.
Molecular Properties
| Compound Name | N-(6-bicyclo[3.2.0]hept-2-enylideneamino)-2-hydroxy-2,2-diphenylacetamide |
| PubChem CID | 5043950 |
| Molecular Formula | C21H20N2O2 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.15 |
| IUPAC Name | N-(6-bicyclo[3.2.0]hept-2-enylideneamino)-2-hydroxy-2,2-diphenylacetamide |
| SMILES | O=C(NN=C1CC2C=CCC12)C(O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H20N2O2/c24-20(23-22-19-14-15-8-7-13-18(15)19)21(25,16-9-3-1-4-10-16)17-11-5-2-6-12-17/h1-12,15,18,25H,13-14H2,(H,23,24) |
| InChIKey | FXGAQUMEOREADN-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 61.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-(6-bicyclo[3.2.0]hept-2-enylideneamino)-2-hydroxy-2,2-diphenylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(6-bicyclo[3.2.0]hept-2-enylideneamino)-2-hydroxy-2,2-diphenylacetamide?
The IUPAC name of N-(6-bicyclo[3.2.0]hept-2-enylideneamino)-2-hydroxy-2,2-diphenylacetamide (CID 5043950) is N-(6-bicyclo[3.2.0]hept-2-enylideneamino)-2-hydroxy-2,2-diphenylacetamide.
What is the SMILES notation for N-(6-bicyclo[3.2.0]hept-2-enylideneamino)-2-hydroxy-2,2-diphenylacetamide?
The canonical SMILES for N-(6-bicyclo[3.2.0]hept-2-enylideneamino)-2-hydroxy-2,2-diphenylacetamide is O=C(NN=C1CC2C=CCC12)C(O)(c1ccccc1)c1ccccc1.
What is the InChIKey of N-(6-bicyclo[3.2.0]hept-2-enylideneamino)-2-hydroxy-2,2-diphenylacetamide?
The InChIKey is FXGAQUMEOREADN-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H20N2O2/c24-20(23-22-19-14-15-8-7-13-18(15)19)21(25,16-9-3-1-4-10-16)17-11-5-2-6-12-17/h1-12,15,18,25H,13-14H2,(H,23,24).
What are the key properties of N-(6-bicyclo[3.2.0]hept-2-enylideneamino)-2-hydroxy-2,2-diphenylacetamide?
N-(6-bicyclo[3.2.0]hept-2-enylideneamino)-2-hydroxy-2,2-diphenylacetamide has a molecular weight of 332.40 g/mol, XLogP of 2.99, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(6-bicyclo[3.2.0]hept-2-enylideneamino)-2-hydroxy-2,2-diphenylacetamide is sourced from PubChem (CID 5043950), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).