C18H18NO4- — CID 5044252
2-[[2-(3-methylphenoxy)acetyl]amino]-3-phenylpropanoate (PubChem CID 5044252) has the molecular formula C18H18NO4- and a molecular weight of 312.35 g/mol. Its IUPAC name is 2-[[2-(3-methylphenoxy)acetyl]amino]-3-phenylpropanoate.
| Compound Name | 2-[[2-(3-methylphenoxy)acetyl]amino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 5044252 |
| Molecular Formula | C18H18NO4- |
| Molecular Weight | 312.35 g/mol |
| Exact Mass | 312.12 |
| IUPAC Name | 2-[[2-(3-methylphenoxy)acetyl]amino]-3-phenylpropanoate |
| SMILES | Cc1cccc(OCC(=O)NC(Cc2ccccc2)C(=O)[O-])c1 |
| InChI | InChI=1S/C18H19NO4/c1-13-6-5-9-15(10-13)23-12-17(20)19-16(18(21)22)11-14-7-3-2-4-8-14/h2-10,16H,11-12H2,1H3,(H,19,20)(H,21,22)/p-1 |
| InChIKey | VGWDIRFNZKTCJE-UHFFFAOYSA-M |
| XLogP | 0.85 |
| TPSA | 78.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.35 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |