C16H9Cl2NO — CID 5044481
2-benzoyl-3-(2,6-dichlorophenyl)prop-2-enenitrile (PubChem CID 5044481) has the molecular formula C16H9Cl2NO and a molecular weight of 302.16 g/mol. Its IUPAC name is 2-benzoyl-3-(2,6-dichlorophenyl)prop-2-enenitrile.
| Compound Name | 2-benzoyl-3-(2,6-dichlorophenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 5044481 |
| Molecular Formula | C16H9Cl2NO |
| Molecular Weight | 302.16 g/mol |
| Exact Mass | 301.01 |
| IUPAC Name | 2-benzoyl-3-(2,6-dichlorophenyl)prop-2-enenitrile |
| SMILES | N#CC(=Cc1c(Cl)cccc1Cl)C(=O)c1ccccc1 |
| InChI | InChI=1S/C16H9Cl2NO/c17-14-7-4-8-15(18)13(14)9-12(10-19)16(20)11-5-2-1-3-6-11/h1-9H |
| InChIKey | WABIGNJSAFBSDL-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.16 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|