methyl 3,4,5-triacetyloxy-6-methylsulfanyloxane-2-carboxylate

C14H20O9S — CID 5044561

IUPACmethyl 3,4,5-triacetyloxy-6-methylsulfanyloxane-2-carboxylate
SMILESCOC(=O)C1OC(SC)C(OC(C)=O)C(OC(C)=O)C1OC(C)=O
InChIInChI=1S/C14H20O9S/c1-6(15)20-9-10(21-7(2)16)12(22-8(3)17)14(24-5)23-11(9)13(18)19-4/h9-12,14H,1-5H3
InChIKeyHHAWIPPOHLEARU-UHFFFAOYSA-N
MW364.37 g/mol
LogP0.04
Rot. Bonds5

About methyl 3,4,5-triacetyloxy-6-methylsulfanyloxane-2-carboxylate

methyl 3,4,5-triacetyloxy-6-methylsulfanyloxane-2-carboxylate (PubChem CID 5044561) has the molecular formula C14H20O9S and a molecular weight of 364.37 g/mol. Its IUPAC name is methyl 3,4,5-triacetyloxy-6-methylsulfanyloxane-2-carboxylate.

Molecular Properties

Compound Namemethyl 3,4,5-triacetyloxy-6-methylsulfanyloxane-2-carboxylate
PubChem CID5044561
Molecular FormulaC14H20O9S
Molecular Weight364.37 g/mol
Exact Mass364.08
IUPAC Namemethyl 3,4,5-triacetyloxy-6-methylsulfanyloxane-2-carboxylate
SMILESCOC(=O)C1OC(SC)C(OC(C)=O)C(OC(C)=O)C1OC(C)=O
InChIInChI=1S/C14H20O9S/c1-6(15)20-9-10(21-7(2)16)12(22-8(3)17)14(24-5)23-11(9)13(18)19-4/h9-12,14H,1-5H3
InChIKeyHHAWIPPOHLEARU-UHFFFAOYSA-N
XLogP0.04
TPSA114.43 Ų
H-Bond Donors
H-Bond Acceptors10
Rotatable Bonds5
Heavy Atoms24
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500364.37
LogP ≤ 50.04
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 1010

Computed Properties (RDKit)

Structural Alerts{'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}

Analyze methyl 3,4,5-triacetyloxy-6-methylsulfanyloxane-2-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 3,4,5-triacetyloxy-6-methylsulfanyloxane-2-carboxylate?
The IUPAC name of methyl 3,4,5-triacetyloxy-6-methylsulfanyloxane-2-carboxylate (CID 5044561) is methyl 3,4,5-triacetyloxy-6-methylsulfanyloxane-2-carboxylate.
What is the SMILES notation for methyl 3,4,5-triacetyloxy-6-methylsulfanyloxane-2-carboxylate?
The canonical SMILES for methyl 3,4,5-triacetyloxy-6-methylsulfanyloxane-2-carboxylate is COC(=O)C1OC(SC)C(OC(C)=O)C(OC(C)=O)C1OC(C)=O.
What is the InChIKey of methyl 3,4,5-triacetyloxy-6-methylsulfanyloxane-2-carboxylate?
The InChIKey is HHAWIPPOHLEARU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20O9S/c1-6(15)20-9-10(21-7(2)16)12(22-8(3)17)14(24-5)23-11(9)13(18)19-4/h9-12,14H,1-5H3.
What are the key properties of methyl 3,4,5-triacetyloxy-6-methylsulfanyloxane-2-carboxylate?
methyl 3,4,5-triacetyloxy-6-methylsulfanyloxane-2-carboxylate has a molecular weight of 364.37 g/mol, XLogP of 0.04, 5 rotatable bonds, 0 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3,4,5-triacetyloxy-6-methylsulfanyloxane-2-carboxylate is sourced from PubChem (CID 5044561), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).