C18H25N3O — CID 504498
(11S)-10-(2,2-dimethylbut-3-enyl)-7,11-dimethyl-1,3,10-triazatricyclo[6.4.1.04,13]trideca-4(13),5,7-trien-2-one (PubChem CID 504498) has the molecular formula C18H25N3O and a molecular weight of 299.42 g/mol. Its IUPAC name is (11S)-10-(2,2-dimethylbut-3-enyl)-7,11-dimethyl-1,3,10-triazatricyclo[6.4.1.04,13]trideca-4(13),5,7-trien-2-one.
| Compound Name | (11S)-10-(2,2-dimethylbut-3-enyl)-7,11-dimethyl-1,3,10-triazatricyclo[6.4.1.04,13]trideca-4(13),5,7-trien-2-one |
|---|---|
| PubChem CID | 504498 |
| Molecular Formula | C18H25N3O |
| Molecular Weight | 299.42 g/mol |
| Exact Mass | 299.20 |
| IUPAC Name | (11S)-10-(2,2-dimethylbut-3-enyl)-7,11-dimethyl-1,3,10-triazatricyclo[6.4.1.04,13]trideca-4(13),5,7-trien-2-one |
| SMILES | C=CC(C)(C)CN1Cc2c(C)ccc3[nH]c(=O)n(c23)C[C@@H]1C |
| InChI | InChI=1S/C18H25N3O/c1-6-18(4,5)11-20-10-14-12(2)7-8-15-16(14)21(9-13(20)3)17(22)19-15/h6-8,13H,1,9-11H2,2-5H3,(H,19,22)/t13-/m0/s1 |
| InChIKey | HLFNLSFZRFXMNC-ZDUSSCGKSA-N |
| XLogP | 3.05 |
| TPSA | 41.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.42 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|