C11H19ClSi — CID 5045335
chloro-dimethyl-(2,3,4,5-tetramethylcyclopenta-2,4-dien-1-yl)silane (PubChem CID 5045335) has the molecular formula C11H19ClSi and a molecular weight of 214.81 g/mol. Its IUPAC name is chloro-dimethyl-(2,3,4,5-tetramethylcyclopenta-2,4-dien-1-yl)silane.
| Compound Name | chloro-dimethyl-(2,3,4,5-tetramethylcyclopenta-2,4-dien-1-yl)silane |
|---|---|
| PubChem CID | 5045335 |
| Molecular Formula | C11H19ClSi |
| Molecular Weight | 214.81 g/mol |
| Exact Mass | 214.09 |
| IUPAC Name | chloro-dimethyl-(2,3,4,5-tetramethylcyclopenta-2,4-dien-1-yl)silane |
| SMILES | CC1=C(C)C([Si](C)(C)Cl)C(C)=C1C |
| InChI | InChI=1S/C11H19ClSi/c1-7-8(2)10(4)11(9(7)3)13(5,6)12/h11H,1-6H3 |
| InChIKey | QTMBNCMQGRJAAA-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.81 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|