C26H20N2O5S2 — CID 5045584
N-(2-oxobenzo[g][1,3]benzoxathiol-5-yl)-N-(2,4,5-trimethylphenyl)sulfonylpyridine-4-carboxamide (PubChem CID 5045584) has the molecular formula C26H20N2O5S2 and a molecular weight of 504.59 g/mol. Its IUPAC name is N-(2-oxobenzo[g][1,3]benzoxathiol-5-yl)-N-(2,4,5-trimethylphenyl)sulfonylpyridine-4-carboxamide.
| Compound Name | N-(2-oxobenzo[g][1,3]benzoxathiol-5-yl)-N-(2,4,5-trimethylphenyl)sulfonylpyridine-4-carboxamide |
|---|---|
| PubChem CID | 5045584 |
| Molecular Formula | C26H20N2O5S2 |
| Molecular Weight | 504.59 g/mol |
| Exact Mass | 504.08 |
| IUPAC Name | N-(2-oxobenzo[g][1,3]benzoxathiol-5-yl)-N-(2,4,5-trimethylphenyl)sulfonylpyridine-4-carboxamide |
| SMILES | Cc1cc(C)c(S(=O)(=O)N(C(=O)c2ccncc2)c2cc3sc(=O)oc3c3ccccc23)cc1C |
| InChI | InChI=1S/C26H20N2O5S2/c1-15-12-17(3)23(13-16(15)2)35(31,32)28(25(29)18-8-10-27-11-9-18)21-14-22-24(33-26(30)34-22)20-7-5-4-6-19(20)21/h4-14H,1-3H3 |
| InChIKey | PFHONTIVUVYHSQ-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 97.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.59 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thio_carbonate_A(15)', 'substructure': 'N/A'} |
|---|