About N-(2-oxobenzo[g][1,3]benzoxathiol-5-yl)-N-quinolin-8-ylsulfonylfuran-2-carboxamide
N-(2-oxobenzo[g][1,3]benzoxathiol-5-yl)-N-quinolin-8-ylsulfonylfuran-2-carboxamide (PubChem CID 5045716) has the molecular formula C25H14N2O6S2
and a molecular weight of 502.53 g/mol. Its IUPAC name is N-(2-oxobenzo[g][1,3]benzoxathiol-5-yl)-N-quinolin-8-ylsulfonylfuran-2-carboxamide.
Molecular Properties
| Compound Name | N-(2-oxobenzo[g][1,3]benzoxathiol-5-yl)-N-quinolin-8-ylsulfonylfuran-2-carboxamide |
| PubChem CID | 5045716 |
| Molecular Formula | C25H14N2O6S2 |
| Molecular Weight | 502.53 g/mol |
| Exact Mass | 502.03 |
| IUPAC Name | N-(2-oxobenzo[g][1,3]benzoxathiol-5-yl)-N-quinolin-8-ylsulfonylfuran-2-carboxamide |
| SMILES | O=C(c1ccco1)N(c1cc2sc(=O)oc2c2ccccc12)S(=O)(=O)c1cccc2cccnc12 |
| InChI | InChI=1S/C25H14N2O6S2/c28-24(19-10-5-13-32-19)27(35(30,31)21-11-3-6-15-7-4-12-26-22(15)21)18-14-20-23(33-25(29)34-20)17-9-2-1-8-16(17)18/h1-14H |
| InChIKey | JQINYWSEPHIDEQ-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 110.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 502.53 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thio_carbonate_A(15)', 'substructure': 'N/A'} |
|---|
Analyze N-(2-oxobenzo[g][1,3]benzoxathiol-5-yl)-N-quinolin-8-ylsulfonylfuran-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-oxobenzo[g][1,3]benzoxathiol-5-yl)-N-quinolin-8-ylsulfonylfuran-2-carboxamide?
The IUPAC name of N-(2-oxobenzo[g][1,3]benzoxathiol-5-yl)-N-quinolin-8-ylsulfonylfuran-2-carboxamide (CID 5045716) is N-(2-oxobenzo[g][1,3]benzoxathiol-5-yl)-N-quinolin-8-ylsulfonylfuran-2-carboxamide.
What is the SMILES notation for N-(2-oxobenzo[g][1,3]benzoxathiol-5-yl)-N-quinolin-8-ylsulfonylfuran-2-carboxamide?
The canonical SMILES for N-(2-oxobenzo[g][1,3]benzoxathiol-5-yl)-N-quinolin-8-ylsulfonylfuran-2-carboxamide is O=C(c1ccco1)N(c1cc2sc(=O)oc2c2ccccc12)S(=O)(=O)c1cccc2cccnc12.
What is the InChIKey of N-(2-oxobenzo[g][1,3]benzoxathiol-5-yl)-N-quinolin-8-ylsulfonylfuran-2-carboxamide?
The InChIKey is JQINYWSEPHIDEQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H14N2O6S2/c28-24(19-10-5-13-32-19)27(35(30,31)21-11-3-6-15-7-4-12-26-22(15)21)18-14-20-23(33-25(29)34-20)17-9-2-1-8-16(17)18/h1-14H.
What are the key properties of N-(2-oxobenzo[g][1,3]benzoxathiol-5-yl)-N-quinolin-8-ylsulfonylfuran-2-carboxamide?
N-(2-oxobenzo[g][1,3]benzoxathiol-5-yl)-N-quinolin-8-ylsulfonylfuran-2-carboxamide has a molecular weight of 502.53 g/mol, XLogP of 5.18, 4 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-oxobenzo[g][1,3]benzoxathiol-5-yl)-N-quinolin-8-ylsulfonylfuran-2-carboxamide is sourced from PubChem (CID 5045716), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).