C18H22ClN3O3 — CID 5046319
3-[3-(4-chlorophenyl)-6-oxopyridazin-1-yl]-N-(3-ethoxypropyl)propanamide (PubChem CID 5046319) has the molecular formula C18H22ClN3O3 and a molecular weight of 363.85 g/mol. Its IUPAC name is 3-[3-(4-chlorophenyl)-6-oxopyridazin-1-yl]-N-(3-ethoxypropyl)propanamide.
| Compound Name | 3-[3-(4-chlorophenyl)-6-oxopyridazin-1-yl]-N-(3-ethoxypropyl)propanamide |
|---|---|
| PubChem CID | 5046319 |
| Molecular Formula | C18H22ClN3O3 |
| Molecular Weight | 363.85 g/mol |
| Exact Mass | 363.13 |
| IUPAC Name | 3-[3-(4-chlorophenyl)-6-oxopyridazin-1-yl]-N-(3-ethoxypropyl)propanamide |
| SMILES | CCOCCCNC(=O)CCn1nc(-c2ccc(Cl)cc2)ccc1=O |
| InChI | InChI=1S/C18H22ClN3O3/c1-2-25-13-3-11-20-17(23)10-12-22-18(24)9-8-16(21-22)14-4-6-15(19)7-5-14/h4-9H,2-3,10-13H2,1H3,(H,20,23) |
| InChIKey | TYCWVWBNNYTCMJ-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.85 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|