About (2-methyl-2,3-dihydroindol-1-yl)-(3-nitro-4-pyrrolidin-1-ylphenyl)methanone
(2-methyl-2,3-dihydroindol-1-yl)-(3-nitro-4-pyrrolidin-1-ylphenyl)methanone (PubChem CID 5046669) has the molecular formula C20H21N3O3
and a molecular weight of 351.41 g/mol. Its IUPAC name is (2-methyl-2,3-dihydroindol-1-yl)-(3-nitro-4-pyrrolidin-1-ylphenyl)methanone.
Molecular Properties
| Compound Name | (2-methyl-2,3-dihydroindol-1-yl)-(3-nitro-4-pyrrolidin-1-ylphenyl)methanone |
| PubChem CID | 5046669 |
| Molecular Formula | C20H21N3O3 |
| Molecular Weight | 351.41 g/mol |
| Exact Mass | 351.16 |
| IUPAC Name | (2-methyl-2,3-dihydroindol-1-yl)-(3-nitro-4-pyrrolidin-1-ylphenyl)methanone |
| SMILES | CC1Cc2ccccc2N1C(=O)c1ccc(N2CCCC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H21N3O3/c1-14-12-15-6-2-3-7-17(15)22(14)20(24)16-8-9-18(19(13-16)23(25)26)21-10-4-5-11-21/h2-3,6-9,13-14H,4-5,10-12H2,1H3 |
| InChIKey | JHWHGQXMPXAJBH-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 66.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.41 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (2-methyl-2,3-dihydroindol-1-yl)-(3-nitro-4-pyrrolidin-1-ylphenyl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-methyl-2,3-dihydroindol-1-yl)-(3-nitro-4-pyrrolidin-1-ylphenyl)methanone?
The IUPAC name of (2-methyl-2,3-dihydroindol-1-yl)-(3-nitro-4-pyrrolidin-1-ylphenyl)methanone (CID 5046669) is (2-methyl-2,3-dihydroindol-1-yl)-(3-nitro-4-pyrrolidin-1-ylphenyl)methanone.
What is the SMILES notation for (2-methyl-2,3-dihydroindol-1-yl)-(3-nitro-4-pyrrolidin-1-ylphenyl)methanone?
The canonical SMILES for (2-methyl-2,3-dihydroindol-1-yl)-(3-nitro-4-pyrrolidin-1-ylphenyl)methanone is CC1Cc2ccccc2N1C(=O)c1ccc(N2CCCC2)c([N+](=O)[O-])c1.
What is the InChIKey of (2-methyl-2,3-dihydroindol-1-yl)-(3-nitro-4-pyrrolidin-1-ylphenyl)methanone?
The InChIKey is JHWHGQXMPXAJBH-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H21N3O3/c1-14-12-15-6-2-3-7-17(15)22(14)20(24)16-8-9-18(19(13-16)23(25)26)21-10-4-5-11-21/h2-3,6-9,13-14H,4-5,10-12H2,1H3.
What are the key properties of (2-methyl-2,3-dihydroindol-1-yl)-(3-nitro-4-pyrrolidin-1-ylphenyl)methanone?
(2-methyl-2,3-dihydroindol-1-yl)-(3-nitro-4-pyrrolidin-1-ylphenyl)methanone has a molecular weight of 351.41 g/mol, XLogP of 3.79, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-methyl-2,3-dihydroindol-1-yl)-(3-nitro-4-pyrrolidin-1-ylphenyl)methanone is sourced from PubChem (CID 5046669), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).