C8H18NO9P — CID 504706
[(2R,3S,4R,5S)-5-acetamido-2,3,4,6-tetrahydroxyhexyl] dihydrogen phosphate (PubChem CID 504706) has the molecular formula C8H18NO9P and a molecular weight of 303.20 g/mol. Its IUPAC name is [(2R,3S,4R,5S)-5-acetamido-2,3,4,6-tetrahydroxyhexyl] dihydrogen phosphate.
| Compound Name | [(2R,3S,4R,5S)-5-acetamido-2,3,4,6-tetrahydroxyhexyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 504706 |
| Molecular Formula | C8H18NO9P |
| Molecular Weight | 303.20 g/mol |
| Exact Mass | 303.07 |
| IUPAC Name | [(2R,3S,4R,5S)-5-acetamido-2,3,4,6-tetrahydroxyhexyl] dihydrogen phosphate |
| SMILES | CC(=O)N[C@@H](CO)[C@@H](O)[C@H](O)[C@H](O)COP(=O)(O)O |
| InChI | InChI=1S/C8H18NO9P/c1-4(11)9-5(2-10)7(13)8(14)6(12)3-18-19(15,16)17/h5-8,10,12-14H,2-3H2,1H3,(H,9,11)(H2,15,16,17)/t5-,6+,7+,8+/m0/s1 |
| InChIKey | WHHOIWRDVIBHSP-LXGUWJNJSA-N |
| XLogP | -3.32 |
| TPSA | 176.78 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.20 |
| LogP ≤ 5 | -3.32 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|