C11H24NO9P — CID 504709
[(2R,3S,4R,5S)-2,3,4,6-tetrahydroxy-5-(pentanoylamino)hexyl] dihydrogen phosphate (PubChem CID 504709) has the molecular formula C11H24NO9P and a molecular weight of 345.29 g/mol. Its IUPAC name is [(2R,3S,4R,5S)-2,3,4,6-tetrahydroxy-5-(pentanoylamino)hexyl] dihydrogen phosphate.
| Compound Name | [(2R,3S,4R,5S)-2,3,4,6-tetrahydroxy-5-(pentanoylamino)hexyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 504709 |
| Molecular Formula | C11H24NO9P |
| Molecular Weight | 345.29 g/mol |
| Exact Mass | 345.12 |
| IUPAC Name | [(2R,3S,4R,5S)-2,3,4,6-tetrahydroxy-5-(pentanoylamino)hexyl] dihydrogen phosphate |
| SMILES | CCCCC(=O)N[C@@H](CO)[C@@H](O)[C@H](O)[C@H](O)COP(=O)(O)O |
| InChI | InChI=1S/C11H24NO9P/c1-2-3-4-9(15)12-7(5-13)10(16)11(17)8(14)6-21-22(18,19)20/h7-8,10-11,13-14,16-17H,2-6H2,1H3,(H,12,15)(H2,18,19,20)/t7-,8+,10+,11+/m0/s1 |
| InChIKey | LDWLZNNKZUCFGF-SCVMZPAESA-N |
| XLogP | -2.15 |
| TPSA | 176.78 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.29 |
| LogP ≤ 5 | -2.15 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|