C12H26NO9P — CID 504714
[(2R,3S,4R,5S)-5-acetamido-2,3,4,6-tetrahydroxyhexyl] diethyl phosphate (PubChem CID 504714) has the molecular formula C12H26NO9P and a molecular weight of 359.31 g/mol. Its IUPAC name is [(2R,3S,4R,5S)-5-acetamido-2,3,4,6-tetrahydroxyhexyl] diethyl phosphate.
| Compound Name | [(2R,3S,4R,5S)-5-acetamido-2,3,4,6-tetrahydroxyhexyl] diethyl phosphate |
|---|---|
| PubChem CID | 504714 |
| Molecular Formula | C12H26NO9P |
| Molecular Weight | 359.31 g/mol |
| Exact Mass | 359.13 |
| IUPAC Name | [(2R,3S,4R,5S)-5-acetamido-2,3,4,6-tetrahydroxyhexyl] diethyl phosphate |
| SMILES | CCOP(=O)(OCC)OC[C@@H](O)[C@@H](O)[C@H](O)[C@H](CO)NC(C)=O |
| InChI | InChI=1S/C12H26NO9P/c1-4-20-23(19,21-5-2)22-7-10(16)12(18)11(17)9(6-14)13-8(3)15/h9-12,14,16-18H,4-7H2,1-3H3,(H,13,15)/t9-,10+,11+,12+/m0/s1 |
| InChIKey | XUOLFRDQUIYYQU-IRCOFANPSA-N |
| XLogP | -1.24 |
| TPSA | 154.78 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.31 |
| LogP ≤ 5 | -1.24 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|