About 6-bromo-N-[(1,3-dimethylpyrazol-4-yl)methyl]-N-methyl-2-phenylquinoline-4-carboxamide
6-bromo-N-[(1,3-dimethylpyrazol-4-yl)methyl]-N-methyl-2-phenylquinoline-4-carboxamide (PubChem CID 5048043) has the molecular formula C23H21BrN4O
and a molecular weight of 449.35 g/mol. Its IUPAC name is 6-bromo-N-[(1,3-dimethylpyrazol-4-yl)methyl]-N-methyl-2-phenylquinoline-4-carboxamide.
Molecular Properties
| Compound Name | 6-bromo-N-[(1,3-dimethylpyrazol-4-yl)methyl]-N-methyl-2-phenylquinoline-4-carboxamide |
| PubChem CID | 5048043 |
| Molecular Formula | C23H21BrN4O |
| Molecular Weight | 449.35 g/mol |
| Exact Mass | 448.09 |
| IUPAC Name | 6-bromo-N-[(1,3-dimethylpyrazol-4-yl)methyl]-N-methyl-2-phenylquinoline-4-carboxamide |
| SMILES | Cc1nn(C)cc1CN(C)C(=O)c1cc(-c2ccccc2)nc2ccc(Br)cc12 |
| InChI | InChI=1S/C23H21BrN4O/c1-15-17(14-28(3)26-15)13-27(2)23(29)20-12-22(16-7-5-4-6-8-16)25-21-10-9-18(24)11-19(20)21/h4-12,14H,13H2,1-3H3 |
| InChIKey | AGHSRUDOCZHHSV-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 449.35 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-bromo-N-[(1,3-dimethylpyrazol-4-yl)methyl]-N-methyl-2-phenylquinoline-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-N-[(1,3-dimethylpyrazol-4-yl)methyl]-N-methyl-2-phenylquinoline-4-carboxamide?
The IUPAC name of 6-bromo-N-[(1,3-dimethylpyrazol-4-yl)methyl]-N-methyl-2-phenylquinoline-4-carboxamide (CID 5048043) is 6-bromo-N-[(1,3-dimethylpyrazol-4-yl)methyl]-N-methyl-2-phenylquinoline-4-carboxamide.
What is the SMILES notation for 6-bromo-N-[(1,3-dimethylpyrazol-4-yl)methyl]-N-methyl-2-phenylquinoline-4-carboxamide?
The canonical SMILES for 6-bromo-N-[(1,3-dimethylpyrazol-4-yl)methyl]-N-methyl-2-phenylquinoline-4-carboxamide is Cc1nn(C)cc1CN(C)C(=O)c1cc(-c2ccccc2)nc2ccc(Br)cc12.
What is the InChIKey of 6-bromo-N-[(1,3-dimethylpyrazol-4-yl)methyl]-N-methyl-2-phenylquinoline-4-carboxamide?
The InChIKey is AGHSRUDOCZHHSV-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H21BrN4O/c1-15-17(14-28(3)26-15)13-27(2)23(29)20-12-22(16-7-5-4-6-8-16)25-21-10-9-18(24)11-19(20)21/h4-12,14H,13H2,1-3H3.
What are the key properties of 6-bromo-N-[(1,3-dimethylpyrazol-4-yl)methyl]-N-methyl-2-phenylquinoline-4-carboxamide?
6-bromo-N-[(1,3-dimethylpyrazol-4-yl)methyl]-N-methyl-2-phenylquinoline-4-carboxamide has a molecular weight of 449.35 g/mol, XLogP of 4.98, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-N-[(1,3-dimethylpyrazol-4-yl)methyl]-N-methyl-2-phenylquinoline-4-carboxamide is sourced from PubChem (CID 5048043), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).