C26H28N7O3P — CID 5048590
3-[5,7-dimethyl-1-morpholin-4-yl-1-(4-nitrophenyl)imino-6-phenylpyrrolo[3,4-d]diazaphosphinin-2-yl]propanenitrile (PubChem CID 5048590) has the molecular formula C26H28N7O3P and a molecular weight of 517.53 g/mol. Its IUPAC name is 3-[5,7-dimethyl-1-morpholin-4-yl-1-(4-nitrophenyl)imino-6-phenylpyrrolo[3,4-d]diazaphosphinin-2-yl]propanenitrile.
| Compound Name | 3-[5,7-dimethyl-1-morpholin-4-yl-1-(4-nitrophenyl)imino-6-phenylpyrrolo[3,4-d]diazaphosphinin-2-yl]propanenitrile |
|---|---|
| PubChem CID | 5048590 |
| Molecular Formula | C26H28N7O3P |
| Molecular Weight | 517.53 g/mol |
| Exact Mass | 517.20 |
| IUPAC Name | 3-[5,7-dimethyl-1-morpholin-4-yl-1-(4-nitrophenyl)imino-6-phenylpyrrolo[3,4-d]diazaphosphinin-2-yl]propanenitrile |
| SMILES | Cc1c2c(c(C)n1-c1ccccc1)P(=Nc1ccc([N+](=O)[O-])cc1)(N1CCOCC1)N(CCC#N)N=C2 |
| InChI | InChI=1S/C26H28N7O3P/c1-20-25-19-28-31(14-6-13-27)37(30-15-17-36-18-16-30,29-22-9-11-24(12-10-22)33(34)35)26(25)21(2)32(20)23-7-4-3-5-8-23/h3-5,7-12,19H,6,14-18H2,1-2H3 |
| InChIKey | HMBJWVJAARLQSF-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 112.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.53 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|