About 4-[N-(2,3-dihydro-1-benzofuran-2-ylmethyl)anilino]-2,4-dioxobutanoic acid
4-[N-(2,3-dihydro-1-benzofuran-2-ylmethyl)anilino]-2,4-dioxobutanoic acid (PubChem CID 504893) has the molecular formula C19H17NO5
and a molecular weight of 339.35 g/mol. Its IUPAC name is 4-[N-(2,3-dihydro-1-benzofuran-2-ylmethyl)anilino]-2,4-dioxobutanoic acid.
Molecular Properties
| Compound Name | 4-[N-(2,3-dihydro-1-benzofuran-2-ylmethyl)anilino]-2,4-dioxobutanoic acid |
| PubChem CID | 504893 |
| Molecular Formula | C19H17NO5 |
| Molecular Weight | 339.35 g/mol |
| Exact Mass | 339.11 |
| IUPAC Name | 4-[N-(2,3-dihydro-1-benzofuran-2-ylmethyl)anilino]-2,4-dioxobutanoic acid |
| SMILES | O=C(O)C(=O)CC(=O)N(CC1Cc2ccccc2O1)c1ccccc1 |
| InChI | InChI=1S/C19H17NO5/c21-16(19(23)24)11-18(22)20(14-7-2-1-3-8-14)12-15-10-13-6-4-5-9-17(13)25-15/h1-9,15H,10-12H2,(H,23,24) |
| InChIKey | MYAXUIOMEAUXKO-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.35 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 4-[N-(2,3-dihydro-1-benzofuran-2-ylmethyl)anilino]-2,4-dioxobutanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[N-(2,3-dihydro-1-benzofuran-2-ylmethyl)anilino]-2,4-dioxobutanoic acid?
The IUPAC name of 4-[N-(2,3-dihydro-1-benzofuran-2-ylmethyl)anilino]-2,4-dioxobutanoic acid (CID 504893) is 4-[N-(2,3-dihydro-1-benzofuran-2-ylmethyl)anilino]-2,4-dioxobutanoic acid.
What is the SMILES notation for 4-[N-(2,3-dihydro-1-benzofuran-2-ylmethyl)anilino]-2,4-dioxobutanoic acid?
The canonical SMILES for 4-[N-(2,3-dihydro-1-benzofuran-2-ylmethyl)anilino]-2,4-dioxobutanoic acid is O=C(O)C(=O)CC(=O)N(CC1Cc2ccccc2O1)c1ccccc1.
What is the InChIKey of 4-[N-(2,3-dihydro-1-benzofuran-2-ylmethyl)anilino]-2,4-dioxobutanoic acid?
The InChIKey is MYAXUIOMEAUXKO-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H17NO5/c21-16(19(23)24)11-18(22)20(14-7-2-1-3-8-14)12-15-10-13-6-4-5-9-17(13)25-15/h1-9,15H,10-12H2,(H,23,24).
What are the key properties of 4-[N-(2,3-dihydro-1-benzofuran-2-ylmethyl)anilino]-2,4-dioxobutanoic acid?
4-[N-(2,3-dihydro-1-benzofuran-2-ylmethyl)anilino]-2,4-dioxobutanoic acid has a molecular weight of 339.35 g/mol, XLogP of 2.07, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[N-(2,3-dihydro-1-benzofuran-2-ylmethyl)anilino]-2,4-dioxobutanoic acid is sourced from PubChem (CID 504893), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).