C25H29Cl2N3O4 — CID 504961
N'-[(3,4-dichlorophenyl)methyl]-N'-[4-(dimethylcarbamoyl)phenyl]-N-(2,2-dimethylpropyl)-2-oxobutanediamide (PubChem CID 504961) has the molecular formula C25H29Cl2N3O4 and a molecular weight of 506.43 g/mol. Its IUPAC name is N'-[(3,4-dichlorophenyl)methyl]-N'-[4-(dimethylcarbamoyl)phenyl]-N-(2,2-dimethylpropyl)-2-oxobutanediamide.
| Compound Name | N'-[(3,4-dichlorophenyl)methyl]-N'-[4-(dimethylcarbamoyl)phenyl]-N-(2,2-dimethylpropyl)-2-oxobutanediamide |
|---|---|
| PubChem CID | 504961 |
| Molecular Formula | C25H29Cl2N3O4 |
| Molecular Weight | 506.43 g/mol |
| Exact Mass | 505.15 |
| IUPAC Name | N'-[(3,4-dichlorophenyl)methyl]-N'-[4-(dimethylcarbamoyl)phenyl]-N-(2,2-dimethylpropyl)-2-oxobutanediamide |
| SMILES | CN(C)C(=O)c1ccc(N(Cc2ccc(Cl)c(Cl)c2)C(=O)CC(=O)C(=O)NCC(C)(C)C)cc1 |
| InChI | InChI=1S/C25H29Cl2N3O4/c1-25(2,3)15-28-23(33)21(31)13-22(32)30(14-16-6-11-19(26)20(27)12-16)18-9-7-17(8-10-18)24(34)29(4)5/h6-12H,13-15H2,1-5H3,(H,28,33) |
| InChIKey | VQWPEODYUKEROU-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.43 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|