C24H26Cl2N2O4 — CID 504965
3-[(3,4-dichlorophenyl)methyl-(6-methyl-3,4-dioxoheptanoyl)amino]-N,N-dimethylbenzamide (PubChem CID 504965) has the molecular formula C24H26Cl2N2O4 and a molecular weight of 477.39 g/mol. Its IUPAC name is 3-[(3,4-dichlorophenyl)methyl-(6-methyl-3,4-dioxoheptanoyl)amino]-N,N-dimethylbenzamide.
| Compound Name | 3-[(3,4-dichlorophenyl)methyl-(6-methyl-3,4-dioxoheptanoyl)amino]-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 504965 |
| Molecular Formula | C24H26Cl2N2O4 |
| Molecular Weight | 477.39 g/mol |
| Exact Mass | 476.13 |
| IUPAC Name | 3-[(3,4-dichlorophenyl)methyl-(6-methyl-3,4-dioxoheptanoyl)amino]-N,N-dimethylbenzamide |
| SMILES | CC(C)CC(=O)C(=O)CC(=O)N(Cc1ccc(Cl)c(Cl)c1)c1cccc(C(=O)N(C)C)c1 |
| InChI | InChI=1S/C24H26Cl2N2O4/c1-15(2)10-21(29)22(30)13-23(31)28(14-16-8-9-19(25)20(26)11-16)18-7-5-6-17(12-18)24(32)27(3)4/h5-9,11-12,15H,10,13-14H2,1-4H3 |
| InChIKey | DIXRDRRXLFWZIB-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.39 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|