C22H21Cl2NO5 — CID 504967
4-[(3,4-dichlorophenyl)methyl-(5-methyl-3,4-dioxoheptanoyl)amino]benzoic acid (PubChem CID 504967) has the molecular formula C22H21Cl2NO5 and a molecular weight of 450.32 g/mol. Its IUPAC name is 4-[(3,4-dichlorophenyl)methyl-(5-methyl-3,4-dioxoheptanoyl)amino]benzoic acid.
| Compound Name | 4-[(3,4-dichlorophenyl)methyl-(5-methyl-3,4-dioxoheptanoyl)amino]benzoic acid |
|---|---|
| PubChem CID | 504967 |
| Molecular Formula | C22H21Cl2NO5 |
| Molecular Weight | 450.32 g/mol |
| Exact Mass | 449.08 |
| IUPAC Name | 4-[(3,4-dichlorophenyl)methyl-(5-methyl-3,4-dioxoheptanoyl)amino]benzoic acid |
| SMILES | CCC(C)C(=O)C(=O)CC(=O)N(Cc1ccc(Cl)c(Cl)c1)c1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C22H21Cl2NO5/c1-3-13(2)21(28)19(26)11-20(27)25(12-14-4-9-17(23)18(24)10-14)16-7-5-15(6-8-16)22(29)30/h4-10,13H,3,11-12H2,1-2H3,(H,29,30) |
| InChIKey | HJCNZHAIJLBECT-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 91.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.32 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|